blob_id stringlengths 40 40 | directory_id stringlengths 40 40 | path stringlengths 3 616 | content_id stringlengths 40 40 | detected_licenses listlengths 0 112 | license_type stringclasses 2
values | repo_name stringlengths 5 115 | snapshot_id stringlengths 40 40 | revision_id stringlengths 40 40 | branch_name stringclasses 777
values | visit_date timestamp[us]date 2015-08-06 10:31:46 2023-09-06 10:44:38 | revision_date timestamp[us]date 1970-01-01 02:38:32 2037-05-03 13:00:00 | committer_date timestamp[us]date 1970-01-01 02:38:32 2023-09-06 01:08:06 | github_id int64 4.92k 681M ⌀ | star_events_count int64 0 209k | fork_events_count int64 0 110k | gha_license_id stringclasses 22
values | gha_event_created_at timestamp[us]date 2012-06-04 01:52:49 2023-09-14 21:59:50 ⌀ | gha_created_at timestamp[us]date 2008-05-22 07:58:19 2023-08-21 12:35:19 ⌀ | gha_language stringclasses 149
values | src_encoding stringclasses 26
values | language stringclasses 1
value | is_vendor bool 2
classes | is_generated bool 2
classes | length_bytes int64 3 10.2M | extension stringclasses 188
values | content stringlengths 3 10.2M | authors listlengths 1 1 | author_id stringlengths 1 132 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
ade16edad2cbac40e9bacca1b0aba5e260577e2f | dfe925c32292ba1e054b86ea660546eb9eac921b | /example/gs/__init__.py | c371d57c6a673838f1d0eb1f56482200e99ebb74 | [] | no_license | keul/example.gs | bc64488d5e67492994b5a12a99d0fa64f1af87de | 5435e9f4fde66b810ff184c25e2dc26aa40900df | refs/heads/master | 2020-04-30T09:50:23.781896 | 2013-05-01T18:02:15 | 2013-05-01T18:02:15 | 9,789,567 | 2 | 1 | null | null | null | null | UTF-8 | Python | false | false | 1,012 | py | # -*- coding: utf8 -*-
import logging
from zope.i18nmessageid import MessageFactory
from example.gs import config
from example.gs.tool import FooTool
from Products.Archetypes import atapi
from Products.CMFCore import utils
logger = logging.getLogger('example.gs')
gsMessageFactory = MessageFactory('example.gs')
def... | [
"luca@keul.it"
] | luca@keul.it |
7714909e86d7cb824a84edc6d8ced3422f107600 | 54d17336ca03801bd9c9ef37be8642b332ab71c4 | /osm/SO/rwlaunchpad/plugins/rwautoscaler/rift/tasklets/rwautoscaler/engine.py | 3bd2645aeb390746fcbf31d24b4a18f0fad50d0f | [] | no_license | dennis-me/Pishahang | 2428379c4f7d3ee85df4b85727ce92e8fe69957a | cdd0abe80a76d533d08a51c7970d8ded06624b7d | refs/heads/master | 2020-09-07T12:35:54.734782 | 2020-01-24T20:11:33 | 2020-01-24T20:11:33 | 220,782,212 | 2 | 0 | null | 2019-11-10T11:46:44 | 2019-11-10T11:46:43 | null | UTF-8 | Python | false | false | 15,508 | py |
#
# Copyright 2016 RIFT.IO Inc
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed ... | [
"github@OrangeOnBlack.de"
] | github@OrangeOnBlack.de |
9dac850c79526f3beabdcec45af6f4746838cae8 | 8890ff61262ff98369464721c165d53aa9febe85 | /oauthlib/oauth2/draft25/parameters.py | 4343dcb259213b64ac4a8ce3151d29588e82f6c1 | [
"Apache-2.0"
] | permissive | Mause/tumblr_conn | 09e91bb86e6310ac3f9b0be292967283990558ea | e0ac78947355e41a8432a2a3e12fb86fb28a4c72 | refs/heads/master | 2022-06-15T05:30:27.737676 | 2013-04-29T20:19:57 | 2013-04-29T20:19:57 | 9,258,639 | 0 | 0 | null | 2022-05-17T03:16:49 | 2013-04-06T10:52:39 | JavaScript | UTF-8 | Python | false | false | 11,616 | py | # -*- coding: utf-8 -*-
from __future__ import absolute_import, unicode_literals
"""
oauthlib.oauth2_draft28.parameters
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
This module contains methods related to `Section 4`_ of the OAuth 2 draft.
.. _`Section 4`: http://tools.ietf.org/html/draft-ietf-oauth-v2-28#section-4
"""
impor... | [
"jack.thatch@gmail.com"
] | jack.thatch@gmail.com |
5d1ed16f74021d81791fe06902bd4b73932fecc5 | 4f9930e15c02cb9a09af70d66b794480b8c9bd57 | /batch2/batch/driver/instance.py | 364815e0ed0adbb5c8d315f693c218f81632683b | [
"MIT"
] | permissive | gsarma/hail | d76aa16d718618c1915b629077fd80cbc4d3b526 | 6aa2d945bb7d57c463d5ab9afb686f18c2941b25 | refs/heads/master | 2020-06-20T06:09:43.408615 | 2019-10-29T21:40:23 | 2019-10-29T21:40:23 | 196,250,453 | 0 | 0 | MIT | 2019-07-10T17:44:48 | 2019-07-10T17:44:47 | null | UTF-8 | Python | false | false | 10,380 | py | import time
import logging
import googleapiclient.errors
import asyncio
import aiohttp
log = logging.getLogger('instance')
class Instance:
@staticmethod
def from_record(inst_pool, record):
ip_address = record['ip_address']
pending = ip_address is None
active = ip_address is not None
... | [
"daniel.zidan.king@gmail.com"
] | daniel.zidan.king@gmail.com |
db2b8203bfcc6e719473a13b065bcf0d51007f50 | b15fd3fa4431c3bc0e9098b8ece4cb1e3bb45d50 | /data_providers/downloader.py | ec29f6d09b6514f00c036b6841ea965efcc7c89b | [] | no_license | SoulDuck/DenseNet | 0cdbb86f0cb4a685585f562374c894c165b3459f | 96581dd8e2df973560cf69ff99da211e91af55bb | refs/heads/master | 2021-07-10T04:22:31.868745 | 2017-10-06T13:23:57 | 2017-10-06T13:23:57 | 105,623,435 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,044 | py | import sys ,os
from urllib import urlretrieve
import tarfile
import zipfile
def report_download_progress(count , block_size , total_size):
pct_complete = float(count * block_size) / total_size
msg = "\r {0:1%} already downloader".format(pct_complete)
sys.stdout.write(msg)
sys.stdout.flush()
def dow... | [
"plznw4me@naver.com"
] | plznw4me@naver.com |
2cd1a1a76fe6766a6854de9064bedf52a1da8564 | a2f9d55d686425c4b47ce150aa1a23ea933055cc | /crossposting/spawnprocess.py | 0fa69d71efbd3ebead59242be16e3f573bf5535b | [] | no_license | wd5/blombum | b31c581f2c36c220164901189be1ba95a8341e0e | fe11efb369fe2cec67af1e79bc8935a266df2f80 | refs/heads/master | 2020-12-25T02:23:30.297939 | 2010-06-29T10:03:31 | 2010-06-29T10:03:31 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 331 | py | #!/usr/bin/python
import subprocess
subprocess.Popen([
'/home/nide/code/kanobu/src/manage.py', 'rebuildindex', '--site_id', '4', '--parse', 'none'
])
subprocess.Popen([
'node', '/home/nide/code/blombum/crossposting/test.js'
], stdin = subprocess.PIPE).communicate('[{somevar: 1}, {somevar: 44}, {somevar: 22}]')
pr... | [
"nide@inbox.ru"
] | nide@inbox.ru |
51da8e312770d0a2581c84ac2ef664dca607d04f | 3d6bb3df9ca1d0de6f749b927531de0790aa2e1d | /full_segmentation_histogram_creator.py | 97bc397018dc6ce79e45c96098caf6d100fa396d | [] | no_license | standardgalactic/kuhner-python | da1d66a6d638a9a379ba6bae2affdf151f8c27c5 | 30b73554cc8bc9d532c8108b34dd1a056596fec7 | refs/heads/master | 2023-07-07T04:18:30.634268 | 2020-04-06T04:37:48 | 2020-04-06T04:37:48 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,715 | py | # -*- coding: utf-8 -*-
"""
Created on Thu Sep 1 12:43:28 2016
@author: lpsmith
"""
from __future__ import division
from os import walk
import lucianSNPLibrary as lsl
nsamples_min = 10 #Arbitrary value: minimum number of samples we require
data10_12 = []
data13_20 = []
data21_50 = []
data51_500 = []
data501_5000 =... | [
"lpsmith@uw.edu"
] | lpsmith@uw.edu |
87eb88d102f76159683c01cee2a711c5e2d9b455 | 3fbd26091ebbc13913f9c7be1aaf10d477c79536 | /week01/zuoye/maoyan_scrapy/.history/manyan/manyan/spiders/maoyan_20200628205729.py | 1a0055be6d8db820c15c61f6e0e0a0a3b3f37f7a | [] | no_license | shuncon/Python001-class01 | d28faf3d5d8e9ea4cee93bcae7143a26fd8c472e | df19758181cdaf37f30d4b518600fc4612590499 | refs/heads/master | 2022-11-13T19:31:27.019214 | 2020-07-10T14:58:25 | 2020-07-10T14:58:25 | 273,135,541 | 0 | 0 | null | 2020-06-18T03:46:56 | 2020-06-18T03:46:55 | null | UTF-8 | Python | false | false | 63 | py | import scrapy
class Maoyanspider(scrapy.Spider):
name= '' | [
"1428834423@qq.com"
] | 1428834423@qq.com |
7f83aa1abe81599af869a8bf8a594a065d07480b | cbf407a1c9f18a6d0b94099586c59f1422933bb5 | /tensorflow_probability/python/distributions/joint_distribution_test.py | 0c69d5acd7131ced38a4030055c85676aa8c2225 | [
"Apache-2.0"
] | permissive | idofr/probability | eef7db7709e0309a6a132d6ce5e2423ae5f9ff17 | c8fa646de563cc3ddc9b375538bf5b613a318a46 | refs/heads/master | 2020-05-05T04:05:34.757494 | 2019-04-04T21:09:57 | 2019-04-04T21:10:45 | 179,697,040 | 1 | 0 | null | 2019-04-05T14:26:21 | 2019-04-05T14:26:21 | null | UTF-8 | Python | false | false | 10,474 | py | # Copyright 2018 The TensorFlow Probability Authors.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law o... | [
"gardener@tensorflow.org"
] | gardener@tensorflow.org |
a7cb86c2e4cbd4332442225c33eccf63b66b7f00 | de4e1332950d37707620c54a9613258c1dd9489c | /dongyeop/4주차/주식가격.py | 66a1fd2587ee46a60471b010445f940fe0c01ebf | [] | no_license | PnuLikeLion9th/Summer_algorithm | 8fe74066b9673fb891b7205f75f808a04c7fe750 | dcfcb6325854b3b4c529451d5c6b162298b53bc1 | refs/heads/master | 2023-07-10T13:57:05.511432 | 2021-08-15T07:50:00 | 2021-08-15T07:50:00 | 378,679,514 | 3 | 10 | null | 2021-08-15T07:50:01 | 2021-06-20T15:32:18 | Python | UTF-8 | Python | false | false | 943 | py | # 브루트포스
# def solution(prices):
# answer=[0]*len(prices)
# for i in range(len(prices)):
# for j in range(i+1,len(prices)):
# if prices[i] <=prices[j]:
# answer[i]+=1
# else:
# answer[i]+=1
# break
# return answer
def solution(pr... | [
"ckehdduq95@gmail.com"
] | ckehdduq95@gmail.com |
a9959f969e1eb4d2abb88b4c50c283f909536ea4 | 3d19e1a316de4d6d96471c64332fff7acfaf1308 | /Users/H/hanse/vol_essen.py | b2d4485b5664a460fc906ebcf35661445fb64799 | [] | no_license | BerilBBJ/scraperwiki-scraper-vault | 4e98837ac3b1cc3a3edb01b8954ed00f341c8fcc | 65ea6a943cc348a9caf3782b900b36446f7e137d | refs/heads/master | 2021-12-02T23:55:58.481210 | 2013-09-30T17:02:59 | 2013-09-30T17:02:59 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,428 | py | import scraperwiki
import lxml.html
pageCounter = 1
while True:
page = scraperwiki.scrape("http://essen.vol.at/welcome.asp?page=%d" % (pageCounter))
root = lxml.html.fromstring(page)
for entry in root.cssselect('div[class="Entry"]'):
data={
"Name":entry.cssselect... | [
"pallih@kaninka.net"
] | pallih@kaninka.net |
bda191301750ca690fb5cac1d9f9abe3f859c48c | b773ca4e5f4a8642149316d3aded4c8b1e6037d2 | /sprint-challenge/aq_dashboard.py | e05d226a6c975acfb3676de3141310ccde108ea6 | [
"MIT"
] | permissive | echiyembekeza/DS-Unit-3-Sprint-3-Productization-and-Cloud | c2157e9078ec49b1f59d28220146a197dda3b25c | 64958ae8e9d2310d6c72606109a6ccf456bc5949 | refs/heads/master | 2020-08-04T18:39:27.405320 | 2019-12-11T03:11:28 | 2019-12-11T03:11:28 | 212,239,896 | 0 | 0 | MIT | 2019-10-02T02:27:48 | 2019-10-02T02:27:48 | null | UTF-8 | Python | false | false | 1,662 | py | """OpenAQ Air Quality Dashboard with Flask."""
from flask import Flask, request
from flask_sqlalchemy import SQLAlchemy
from decouple import config
from os import getenv
import openaq
APP = Flask(__name__)
APP.config['SQLALCHEMY_DATABASE_URI'] = 'sqlite:///db.sqlite3'
DB = SQLAlchemy(APP)
API = openaq.OpenAQ()
mmen... | [
"username@users.noreply.github.com"
] | username@users.noreply.github.com |
695d0d073402440740fc8500b7e5f345c02b68c8 | 55c250525bd7198ac905b1f2f86d16a44f73e03a | /Python/Projects/Learn/PyCharm/Introduction to Python/Condition expressions/Boolean operators/tests.py | 470706706d0ff91198294d3ffe34a83d348960e6 | [
"LicenseRef-scancode-other-permissive"
] | permissive | NateWeiler/Resources | 213d18ba86f7cc9d845741b8571b9e2c2c6be916 | bd4a8a82a3e83a381c97d19e5df42cbababfc66c | refs/heads/master | 2023-09-03T17:50:31.937137 | 2023-08-28T23:50:57 | 2023-08-28T23:50:57 | 267,368,545 | 2 | 1 | null | 2022-09-08T15:20:18 | 2020-05-27T16:18:17 | null | UTF-8 | Python | false | false | 128 | py | version https://git-lfs.github.com/spec/v1
oid sha256:539e49395fbd7e0e4b30294456efe7d922a26823d5ac4c0eea6d348bb18cfba3
size 413
| [
"nateweiler84@gmail.com"
] | nateweiler84@gmail.com |
318a74534f2ec00ecb9d3d2d90042ac5ad963a45 | 56a7dd75f2a3f45d599ca89aaa9ca45390fbd546 | /ejercicios_preparcialito/parcialito_2/diccionarios/ejercicio_62.py | 28412a76c350229698e62a66e240a63a6c3ce189 | [] | no_license | facundoPri/algoritmo-programacion-i-essaya | e030d74de832b7642ff84a77212f8ea429d560d8 | 5ff7a8fc66f6683d47bc9faf80a35f9902b1e1a3 | refs/heads/master | 2023-04-07T01:04:10.221473 | 2021-04-10T13:05:59 | 2021-04-10T13:05:59 | 299,450,415 | 0 | 1 | null | null | null | null | UTF-8 | Python | false | false | 563 | py | """
Escribir una función que reciba una cadena y devuelva un diccionario cuyas claves sean las letras y cuyos valores sean la cantidad de apariciones de dicha letra. Por ejemplo, si recibe 'catamarca' debe devolver: {'c':2, 'a':4, 't':1, 'r':1, 'm':1}.
"""
def contar_caracteres(cadena):
"""
Recibe una cadena
... | [
"facundo.prieto321@gmail.com"
] | facundo.prieto321@gmail.com |
ec8498ae54869540f229014677d6853284fde9fc | d4c67b2a12e990d4193e7ab06f04824a348067bf | /rl_trainer/ddpg_impl/flower/actor_critic/tf_ddpg_agent.py | 68c2dcbba15a6708b6789a492d9ba35ba24c020f | [
"BSD-3-Clause"
] | permissive | Roboy/nips-2018-ai-for-prosthetics | 2d57688ce85126379793e8643cbf0030c8f56beb | acb69f267a0cc852842828edbbfb47d1840c0a17 | refs/heads/master | 2020-03-26T05:39:25.565440 | 2018-11-01T23:28:08 | 2018-11-01T23:28:08 | 144,567,613 | 3 | 0 | null | null | null | null | UTF-8 | Python | false | false | 4,073 | py | import numpy as np
from typing import Callable, Collection
import tensorflow as tf
from gym.spaces import Box
from overrides import overrides
from typeguard import typechecked
from rl_trainer.agent import GymAgent
from rl_trainer.agent.replay_buffer import ReplayBuffer, InMemoryReplayBuffer
from rl_trainer.commons im... | [
"tomas.ruiz.te@gmail.com"
] | tomas.ruiz.te@gmail.com |
e1c04602eb11935c3019f76fedd8f5debbf6c2c4 | b9c4c4e2ba9a54cf79169bb2c43e29b6994618f4 | /source/webapp/models.py | 5d3cd21c50b5fbf0b491d7e211c3065189b6e5ec | [] | no_license | big-arturka/exam_9 | 37bf8be08e0fd922bf36b0663babd4611d1ffb04 | 3505e39d9e2110c2912fc7f474e6ec297a8df4dd | refs/heads/master | 2022-12-31T14:06:53.576579 | 2020-10-24T13:24:24 | 2020-10-24T13:24:24 | 306,677,149 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,384 | py | from django.contrib.auth import get_user_model
from django.contrib.auth.models import User
from django.db import models
class Photo(models.Model):
image = models.ImageField(upload_to='images', verbose_name='Фото')
signature = models.CharField(max_length=200, verbose_name='Подпись')
created_at = models.Dat... | [
"arturkrmnlv10@gmail.com"
] | arturkrmnlv10@gmail.com |
f09b5ba0c63513fae5eb3bf59e46085513e482a1 | 77166c6ed9b872fa69b454d3682f63527f5f3951 | /arcade/text.py | eb69a21fd6aad532e3894f36ed8a51fdfd3f1d17 | [
"MIT"
] | permissive | biggzlar/arcade | d72d936f3c244a9d5173b6f36bca3ede3382a0ae | fc444db356452660ac6cb2ffe241f0b1a3d4bcf3 | refs/heads/master | 2020-12-14T06:30:18.997456 | 2020-01-18T04:44:03 | 2020-01-18T04:44:03 | 234,668,560 | 1 | 0 | NOASSERTION | 2020-01-18T02:07:41 | 2020-01-18T02:07:40 | null | UTF-8 | Python | false | false | 12,133 | py | # --- BEGIN TEXT FUNCTIONS # # #
from typing import Tuple, Union, cast
import PIL.Image
import PIL.ImageDraw
import PIL.ImageFont
from arcade.sprite import Sprite
from arcade.arcade_types import Color
from arcade.draw_commands import Texture
from arcade.arcade_types import RGBA
from arcade.draw_commands import get_f... | [
"paul@cravenfamily.com"
] | paul@cravenfamily.com |
d9688ce59735aea7ef8f1d52da614763b7f2d036 | dbe1f4110921a08cb13e22ea325d503bd5627195 | /chuhuo_2.7_clickhouse/bluedon/bdwafd/newscantools/plugins/SiteEngine5_xPagejumpScript.py | 36b3f98ef2796868c8a3a3a6381ac72f04f32ea9 | [] | no_license | Hehouhua/waf_branches | 92dc1b1cbecba20f24ef6c7372dde7caa43f9158 | ca76f3a1ed8150b423474c9e37aee37841a5ee35 | refs/heads/main | 2023-01-07T11:33:31.667688 | 2020-11-03T06:58:33 | 2020-11-03T06:58:33 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,184 | py | #!/usr/bin/env python
# -*- coding: utf-8 -*-
from lib.common import *
def run_domain(http,ob):
list = []
try:
domain = ob['domain']
detail = u''
url = "%s://%s%s" % (ob['scheme'],ob['domain'],ob['base_path'])
expurl="%s%s"%(url,"admin/images/css.css")
url+="api.php?ac... | [
"hanson_wong@qq.com"
] | hanson_wong@qq.com |
39a870579ef4ed97598cbc4f4f6818c96489c04f | bf2704bf2a65eda229fe52dc3bc37d30655ad3db | /microsip_consolidador/settings/common.py | 9e54dbf1eb5d8ef31c6c19af059d8f79338e5a89 | [] | no_license | ruff0/microsip_consolidador | 29276c6f96e2f2d3fb9eb06006234e7773c1aa8f | e8763651c5935d12f93a5413ea593dea16043f64 | refs/heads/master | 2021-05-03T22:02:45.045087 | 2014-04-02T00:50:36 | 2014-04-02T00:50:36 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 9,516 | py | #encoding:utf-8
# Identificando la ruta del proyecto
import os
import fdb
import sqlite3
from local_settings import MICROSIP_MODULES
RUTA_PROYECTO =os.path.dirname(os.path.realpath(__file__)).strip('settings')
ADMINS = (
# ('Your Name', 'your_email@example.com'),
)
MANAGERS = ADMINS
DATABASE_ROUTERS = ['microsip... | [
"jesusmaherrera@gmail.com"
] | jesusmaherrera@gmail.com |
f06b314effbea49196936e04d020d70611e2ee01 | 3f9dd28efb7fb66b95a7b33ae3d15f6e4d0925f5 | /pydar/format.py | d8e1bb84cbbd5663e6463bfea12ee2347e12622b | [
"MIT"
] | permissive | MomsFriendlyRobotCompany/pydar | 926cdbb9431204b60a0816815904c1b27f415f0d | 20d5a6b382b4f047ba19f8f82a15a67ab3537543 | refs/heads/master | 2020-03-20T11:19:28.451746 | 2019-12-25T01:46:29 | 2019-12-25T01:46:29 | 137,399,625 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 80 | py |
from collections import namedtuple
Scan = namedtuple('Scan', 'scan timestamp')
| [
"walchko@users.noreply.github.com"
] | walchko@users.noreply.github.com |
2e858c17d93645b79fec3bc950bfad4291ef27b3 | 4e96f383d4703ad8ee58869ed91a0c8432c8a051 | /Cura/Cura/cura/Backups/BackupsManager.py | ba6fcab8d75e54207a7423215cf29cc707d74109 | [
"LGPL-3.0-only",
"GPL-3.0-only"
] | permissive | flight7788/3d-printing-with-moveo-1 | b2dba26010c4fa31815bc1d2d0966161a8600081 | 7fcb9c6b5da9245d54ac917de8c2a7f5148e42b0 | refs/heads/Feature_Marlin_with_AlanBoy | 2022-08-30T18:36:44.785058 | 2020-05-30T07:52:58 | 2020-05-30T07:52:58 | 212,583,912 | 0 | 0 | MIT | 2020-05-16T07:39:47 | 2019-10-03T13:13:01 | C | UTF-8 | Python | false | false | 3,039 | py | # Copyright (c) 2018 Ultimaker B.V.
# Cura is released under the terms of the LGPLv3 or higher.
from typing import Dict, Optional, Tuple, TYPE_CHECKING
from UM.Logger import Logger
from cura.Backups.Backup import Backup
if TYPE_CHECKING:
from cura.CuraApplication import CuraApplication
## The BackupsManager i... | [
"t106360212@ntut.org.tw"
] | t106360212@ntut.org.tw |
3c639d64247b4a49b28c974d5d915777ea97abc0 | f0d713996eb095bcdc701f3fab0a8110b8541cbb | /egHeSWSjHTgzMysBX_11.py | 07299dceba5a669196df27a142df5458fa762af5 | [] | no_license | daniel-reich/turbo-robot | feda6c0523bb83ab8954b6d06302bfec5b16ebdf | a7a25c63097674c0a81675eed7e6b763785f1c41 | refs/heads/main | 2023-03-26T01:55:14.210264 | 2021-03-23T16:08:01 | 2021-03-23T16:08:01 | 350,773,815 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 501 | py | """
Create a function that takes a number as an argument and returns half of it.
### Examples
half_a_fraction("1/2") ➞ "1/4"
half_a_fraction("6/8") ➞ "3/8"
half_a_fraction("3/8") ➞ "3/16"
### Notes
Always return the simplified fraction.
"""
def half_a_fraction(fract):
fraction = fract.... | [
"daniel.reich@danielreichs-MacBook-Pro.local"
] | daniel.reich@danielreichs-MacBook-Pro.local |
22cca10d1314023d365cc0bdaae9d23ec9feeb56 | ac4b9385b7ad2063ea51237fbd8d1b74baffd016 | /.history/utils/ocr/handle_image_20210209170155.py | 17a1ffee42abc92b121aff59d84aa5bebaf2bf31 | [] | no_license | preethanpa/ssoemprep | 76297ef21b1d4893f1ac2f307f60ec72fc3e7c6f | ce37127845253c768d01aeae85e5d0d1ade64516 | refs/heads/main | 2023-03-09T00:15:55.130818 | 2021-02-20T06:54:58 | 2021-02-20T06:54:58 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 4,092 | py | import os
import cv2
import re
import numpy as np
from PIL import Image
import pytesseract
from pytesseract import Output
from fpdf import FPDF
'''
IMAGE HANDLING METHODS
'''
# get grayscale image
def get_grayscale(image):
return cv2.cvtColor(image, cv2.COLOR_BGR2GRAY)
# blur removal
def remove_blur(image):
... | [
"{abhi@third-ray.com}"
] | {abhi@third-ray.com} |
b15ae00c90717a2a67c39cb9e72a1951ed5f1ae4 | 53fab060fa262e5d5026e0807d93c75fb81e67b9 | /backup/user_217/ch21_2019_08_26_19_58_29_478795.py | 8e46bdfeb1e79e43246166f70246709b75ed0188 | [] | no_license | gabriellaec/desoft-analise-exercicios | b77c6999424c5ce7e44086a12589a0ad43d6adca | 01940ab0897aa6005764fc220b900e4d6161d36b | refs/heads/main | 2023-01-31T17:19:42.050628 | 2020-12-16T05:21:31 | 2020-12-16T05:21:31 | 306,735,108 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 184 | py | def valor_da_conta(valor):
valor = int(input('Qual valor da conta?:' ))
com10% = valor + valor*(10/100)
return com10%
print("Valor da conta com 10%: R${0}".format(com10%)) | [
"you@example.com"
] | you@example.com |
a673490634f6d5ccbf0aab99ff19ac353dd7567a | c21faf85627b1cfd96494aac73cc40e5f11ebb46 | /results/test_188.py | 0b34ac896ae50c37329c5d2aad8aae65d061d40a | [] | no_license | ekkya/Cyclomatic-Complexity | d02c61e009087e7d51738e60605875741532b878 | 172db2efdd974f5abad964e335552aec974b47cb | refs/heads/master | 2021-08-28T17:13:14.718314 | 2017-12-12T22:04:13 | 2017-12-12T22:04:13 | 112,042,202 | 0 | 1 | null | null | null | null | UTF-8 | Python | false | false | 102,256 | py | """
Author: Ankit Agarwal (ankit167)
Usage: python google.py <keyword>
Description: Script googles the keyword and opens
top 5 (max) search results in separate
tabs in the browser
Version: 1.0
"""
import webbrowser, sys, pyperclip, requests, bs4
def main():
if len(sys.argv) > 1:
keyword =... | [
"ekkya@tcd.ie"
] | ekkya@tcd.ie |
6c907dbb07bf1ef1ce4fdced214be391d28b2ca8 | eda9187adfd53c03f55207ad05d09d2d118baa4f | /python3_base/python_class_method.py | 4bb8dc5866ce970db1d955879a443c4426f31c41 | [] | no_license | HuiZhaozh/python_tutorials | 168761c9d21ad127a604512d7c6c6b38b4faa3c7 | bde4245741081656875bcba2e4e4fcb6b711a3d9 | refs/heads/master | 2023-07-07T20:36:20.137647 | 2020-04-24T07:18:25 | 2020-04-24T07:18:25 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,137 | py | # -*- coding:utf-8 -*-
# /usr/bin/python
'''
@Author: Yan Errol
@Email:2681506@gmail.com
@Date: 2019-05-20 17:22
@File：class_method.py
@Describe:静态方法
'''
from math import sqrt
class Triangle(object):
def __init__(self, a, b, c):
self._a = a
self._b = b
self._c = c
@staticmeth... | [
"2681506@gmail.com"
] | 2681506@gmail.com |
b6db4caaa1b3f409974642244d2e45e58bea2b74 | d94d22ab20a11ab6c473d8aba4038c97f75806c4 | /python小栗子/t57.py | c34766c279355c2457734c45293ae01587fccbaf | [] | no_license | songszw/python | a1d0419b995df13aee5997d24c09dccab91ac9e0 | 5135a3efcdcc2a37f7321ae19271c9315f48bcaf | refs/heads/master | 2020-02-26T16:24:28.411919 | 2017-04-26T09:08:41 | 2017-04-26T09:08:41 | 71,195,225 | 2 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,392 | py | print('|--- 欢迎进入宋氏通讯录 ---|')
print('|--- 1：查询联系人资料 ---|')
print('|--- 2：插入新的联系人 ---|')
print('|--- 3：删除已有联系人 ---|')
print('|--- 4：退出通讯录程序 ---|')
contacts = dict()
while 1:
num = int(input('please enter the number you want to do: '))
if num==1:
name = input('please enter the name you waht to... | [
"noreply@github.com"
] | songszw.noreply@github.com |
100efc94fe97678e4d050167f49f1a7ead921301 | 4dd87e032760f77855727a36c02ab670d9ca8ff8 | /file-uploader/appengine_config.py | 21778b35475168809f3e6b5f3adbd15fdeca3de6 | [] | no_license | ramuta/gaedevs-examples | 09f14ae4fd444d898483f303aead08fd93839935 | f8a077bad98a2f40739d59321aad67dad6407c54 | refs/heads/master | 2020-04-08T09:56:13.315017 | 2018-11-27T17:01:33 | 2018-11-27T17:01:33 | 159,246,286 | 5 | 0 | null | null | null | null | UTF-8 | Python | false | false | 60 | py | from google.appengine.ext import vendor
vendor.add('libs')
| [
"matej.ramuta@gmail.com"
] | matej.ramuta@gmail.com |
509b043958ecf41f0f38c5f2c9c22a9f3826f34b | 074279d6b63c9cd25c1353624710ed1fb422b30f | /j2ee模式-前端控制器模式.py | 53e5ab14544ddcb6c8ff3233c365a535f8179b88 | [] | no_license | qqizai/python36patterns | edd106f496a1aa7eda5d9070a6d82f142a808621 | 39052df13db9a54cb8322d87edbc2dbe6ff06a07 | refs/heads/master | 2022-11-12T14:01:32.341802 | 2020-06-29T02:23:46 | 2020-06-29T02:23:46 | 281,970,231 | 0 | 1 | null | 2020-07-23T14:13:31 | 2020-07-23T14:13:30 | null | UTF-8 | Python | false | false | 2,562 | py | # -*- coding: utf-8 -*-
# @Author : ydf
# @Time : 2019/10/9 0009 15:32
"""
前端控制器模式（Front Controller Pattern）是用来提供一个集中的请求处理机制，所有的请求都将由一个单一的处理程序处理。该处理程序可以做认证/授权/记录日志，或者跟踪请求，然后把请求传给相应的处理程序。以下是这种设计模式的实体。
前端控制器（Front Controller） - 处理应用程序所有类型请求的单个处理程序，应用程序可以是基于 web 的应用程序，也可以是基于桌面的应用程序。
调度器（Dispatcher） - 前端控制器可能使用一个调度器对... | [
"909686719@qq.com"
] | 909686719@qq.com |
d81ca3d2f986e4c7af9c64432aef10385266e46b | 8cc30a27835e205a3476783106ca1605a6a85c48 | /amy/workshops/migrations/0066_merge.py | ef0455252831a8b0cfaf3e51343f4267be07ade1 | [
"MIT"
] | permissive | gaybro8777/amy | d968edc78bbd3f63f3353450334721628dbbc0f4 | 3cf99aed58a0f0acf83d2645a30d8408208ccea9 | refs/heads/develop | 2023-03-07T22:08:28.692700 | 2021-02-23T18:06:06 | 2021-02-23T18:06:06 | 341,930,505 | 0 | 0 | MIT | 2021-02-24T17:22:08 | 2021-02-24T14:40:43 | null | UTF-8 | Python | false | false | 304 | py | # -*- coding: utf-8 -*-
from __future__ import unicode_literals
from django.db import models, migrations
class Migration(migrations.Migration):
dependencies = [
('workshops', '0064_dc_instructor_badge'),
('workshops', '0065_multiple_memberships'),
]
operations = [
]
| [
"piotr@banaszkiewicz.org"
] | piotr@banaszkiewicz.org |
f9023a1da5efba1124204d1d8a76778d9c15c29d | d18f74c0683fa412833fc7b68f737226dcf0f5df | /setup.py | 70e68c224d914b125b04f0aa01c8f602ff39fa0f | [] | no_license | phymhan/gomoku | ab22b19c2f59ea63aba3015f2b3ce53bf1b440e5 | e48e215fe24236ccccfa5edb0709a22bed4624b9 | refs/heads/master | 2021-08-28T23:06:50.620937 | 2017-12-13T07:49:45 | 2017-12-13T07:49:45 | 114,087,358 | 5 | 1 | null | null | null | null | UTF-8 | Python | false | false | 1,361 | py | import cx_Freeze
executables = [cx_Freeze.Executable("fivechessonline21.py")]
cx_Freeze.setup(
name = "Five-Chess",
options = {"build_exe": {"packages": ["pygame"],
"include_files": ["./sources/pics/board.png",
"./sources/pics/cp_k_29... | [
"hanligong@gmail.com"
] | hanligong@gmail.com |
54fdb90defd17f79a01648b7ef2c33d62cb46d3b | c4b8e1e09dedbccd37ca008ecaaca4438610bbaf | /cpmpy/sliding_sum.py | 01b48796c45a4a65f16a0e45cf1d93b7cf1cdcf1 | [
"MIT"
] | permissive | hakank/hakank | 4806598b98cb36dd51b24b0ab688f52dadfe9626 | c337aaf8187f15dcdc4d5b09cd2ed0dbdb2e72c2 | refs/heads/master | 2023-08-15T00:21:52.750270 | 2023-07-27T16:21:40 | 2023-07-27T16:21:40 | 11,933,517 | 336 | 97 | MIT | 2023-07-27T11:19:42 | 2013-08-06T20:12:10 | JavaScript | UTF-8 | Python | false | false | 1,355 | py | """
Sliding sum constraint in cpmpy.
From Global Constraint Catalogue
http://www.emn.fr/x-info/sdemasse/gccat/Csliding_sum.html
'''
sliding_sum(LOW,UP,SEQ,VARIABLES)
Purpose
Constrains all sequences of SEQ consecutive variables of the collection VARIABLES so that the
sum of the variables belongs to interval [LOW, U... | [
"hakank@gmail.com"
] | hakank@gmail.com |
c73953e48af931827b1da62eb65e647668cfd10d | 5e45f1d1d9f58aa1456777b0d75334d6efd43840 | /challenges/hackerrank/algorithms/dynamic/max_subarray/python/max_subarray.py | 7a4bd11931255b0775dd3b4438356b773e6b06e1 | [] | no_license | missingdays/nerdy.school | 604953dc9b3c38a0f71793f066ce2707aa980dae | 051673e0ebc54bc2f7e96a6477697d1d528dc45c | refs/heads/master | 2021-01-17T08:10:19.558851 | 2016-06-06T15:29:01 | 2016-06-06T15:29:01 | 59,897,184 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,187 | py | #! /usr/bin/env python
# -*- coding: utf-8 -*-
# vim:fenc=utf-8
#
# Copyright © 2015 missingdays <missingdays@missingdays>
#
# Distributed under terms of the MIT license.
"""
Maximum subarray problem solution
"""
def max_subarray(array):
curr_sum = 0
curr_index = 0
best_sum = 0
best_start_index = 0
... | [
"rebovykin@gmail.com"
] | rebovykin@gmail.com |
878bdb34e11bc1501de1b6b0dfd2018dfcf3aa4a | 63191be7f688591af69263972d68423d76fb5f74 | /geekshop/adminapp/views/categories.py | b42b65dd0c4181601279fe52418c7aef8c7ee7a5 | [] | no_license | IliaNiyazof/Django | 5eee4c226a1f06178fdbb5626444fff406886de7 | 052cb4f3f142c4224454ebac9fb27f63de9cbc47 | refs/heads/master | 2021-07-19T05:52:56.620026 | 2020-06-05T16:17:47 | 2020-06-05T16:17:47 | 166,776,966 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,332 | py | from django.contrib.auth.decorators import user_passes_test
from django.shortcuts import render, HttpResponseRedirect, reverse, get_object_or_404
from mainapp.models import ProductCategory
from adminapp.models.categories import ProductCategoryEditForm
@user_passes_test(lambda u: u.is_superuser)
def categories(request... | [
"IFHRJCFY@yandex.ru"
] | IFHRJCFY@yandex.ru |
91feb4ba59077254f4d6a9ed644bd5d3663554bf | 60bb3ef7dd8a147761918f1fa021918d6898202d | /.history/main_20210623141903.py | eee65d95a67254bb6a9d60f7a4da85315eba9d6c | [] | no_license | sanjayMamidipaka/bbtautomationscripts | c1d29d9ea5c0fa982a53895b10db50b66e475c8f | 12c35a3459cb0ead71ae616b2efad21c555cf8a0 | refs/heads/master | 2023-06-06T06:25:09.152797 | 2021-06-23T18:21:34 | 2021-06-23T18:21:34 | 362,836,875 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 5,370 | py | import pandas as pd
import numpy as np
import csv
import xlsxwriter
from timeprofile import timeprofile
from masterdata import masterdata
from virtualReference import virtualReference
from keyfigures import keyfigures
from planninglevels import planninglevels
from attributesaskf import attributesaskf
from attributes im... | [
"sanjay.mamidipaka@gmail.com"
] | sanjay.mamidipaka@gmail.com |
ad56100aae986b9d39225d2009c1864556132f8f | 5a7a3447d434a458a7bb63f2aa11b64c284d5492 | /test/image_load.py | 834165562d2d100c68a6bd98d20ca2faaea7dd90 | [] | no_license | woshimayi/mypython | 35792e12036a7a05f12d3ef7006637b2b03f0e2e | 7f1eb38e8585bf6d2f21d3ad0f64dace61425875 | refs/heads/master | 2023-09-01T08:59:12.301836 | 2023-08-30T05:30:54 | 2023-08-30T05:30:54 | 130,017,052 | 4 | 0 | null | 2018-12-02T16:18:14 | 2018-04-18T06:50:36 | HTML | UTF-8 | Python | false | false | 622 | py | #coding=utf-8
import urllib
import re
def getHtml(url):
page = urllib.urlopen(url)
html = page.read()
return html
def getImg(html):
reg = r'src="(.+?\.jpg)" pic_ext'
imgre = re.compile(reg)
imglist = re.findall(imgre,html)
x = 0
for imgurl in imglist:
urllib.urlretrieve(imgurl,... | [
"woshidamayi@Gmail.com"
] | woshidamayi@Gmail.com |
ef9743d94d29deebd30fc55ae31439a2db8b093d | f87f51ec4d9353bc3836e22ac4a944951f9c45c0 | /.history/HW06_20210715222321.py | fcf2188b6928a2756355ea80e53ded7f525f6620 | [] | no_license | sanjayMamidipaka/cs1301 | deaffee3847519eb85030d1bd82ae11e734bc1b7 | 9ddb66596497382d807673eba96853a17884d67b | refs/heads/main | 2023-06-25T04:52:28.153535 | 2021-07-26T16:42:44 | 2021-07-26T16:42:44 | 389,703,530 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 4,763 | py | """
Georgia Institute of Technology - CS1301
HW06 - Text Files & CSV
Collaboration Statement:
"""
#########################################
"""
Function Name: findCuisine()
Parameters: filename (str), cuisine (str)
Returns: list of restaurants (list)
"""
#########################################
########## WRITE FUN... | [
"sanjay.mamidipaka@gmail.com"
] | sanjay.mamidipaka@gmail.com |
27b40d5f4d6e34ca94bb8678bc5ab493499da234 | a1431c25ebd62daead742e0120a16253c4cf67ca | /env/bin/rst2pseudoxml.py | f5df7e1eeb081261c7377ab286cc4b34ed5a0fc3 | [] | no_license | KonradMarzec1991/my_MDB | f840cbf495c23272b3e39db68c241219a60d63bd | d77339a4c37a3d7ae21b6d28bd9644ce15130f10 | refs/heads/master | 2022-04-29T10:15:37.109422 | 2019-11-03T20:13:57 | 2019-11-03T20:13:57 | 207,375,063 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 636 | py | #!/home/konrad/PycharmProjects/my_mdb/env/bin/python3
# $Id: rst2pseudoxml.py 4564 2006-05-21 20:44:42Z wiemann $
# Author: David Goodger <goodger@python.org>
# Copyright: This module has been placed in the public domain.
"""
A minimal front end to the Docutils Publisher, producing pseudo-XML.
"""
try:
import lo... | [
"konrimarzec@gmail.com"
] | konrimarzec@gmail.com |
1a17c0e753532ecf7f5f5d0b99fb308e5ec83ca9 | bdcab42a9124d7a3878a904076170bd4bff7451f | /src/hessian/random_sample_points.py | 44047bd5934ab4c7ec808b9b9c3a87972695717a | [] | no_license | hwang595/data_augmentation_playground | aa30685213083bb271ae56996d8aff831ef975ab | 5b11a5d5c2d9254b5ffa293eebf8e3e6269edd69 | refs/heads/master | 2021-01-25T09:14:30.059368 | 2020-03-01T21:33:06 | 2020-03-01T21:33:06 | 93,801,194 | 2 | 1 | null | null | null | null | UTF-8 | Python | false | false | 5,705 | py | import numpy as np
from sklearn.decomposition import PCA
import matplotlib.pyplot as plt
from mpl_toolkits.mplot3d import Axes3D
DIST_ = 20
def rand_point_generator(point_num=None):
'''
we want y \in [1.5, 2.5], x \in [-0.5 0.5] for datapoints with label 1
we want y \in [-0.5, 0.5], x \in [1.5 2.5] for datapoints... | [
"hongyiwang@cs.wisc.edu"
] | hongyiwang@cs.wisc.edu |
475f56cddea7da88cb0c4c18cc4e1649dc2a16ba | 7bededcada9271d92f34da6dae7088f3faf61c02 | /pypureclient/flashblade/FB_2_8/models/keytab_file_base64.py | e7f84a50b47b69c9b000c62ecaa4a1e8b70b635e | [
"BSD-2-Clause"
] | permissive | PureStorage-OpenConnect/py-pure-client | a5348c6a153f8c809d6e3cf734d95d6946c5f659 | 7e3c3ec1d639fb004627e94d3d63a6fdc141ae1e | refs/heads/master | 2023-09-04T10:59:03.009972 | 2023-08-25T07:40:41 | 2023-08-25T07:40:41 | 160,391,444 | 18 | 29 | BSD-2-Clause | 2023-09-08T09:08:30 | 2018-12-04T17:02:51 | Python | UTF-8 | Python | false | false | 2,912 | py | # coding: utf-8
"""
FlashBlade REST API
A lightweight client for FlashBlade REST API 2.8, developed by Pure Storage, Inc. (http://www.purestorage.com/).
OpenAPI spec version: 2.8
Generated by: https://github.com/swagger-api/swagger-codegen.git
"""
import pprint
import re
import six
import typ... | [
"tlewis@purestorage.com"
] | tlewis@purestorage.com |
54aa25a623bcd141ceb60503e4862c6560334415 | 53fab060fa262e5d5026e0807d93c75fb81e67b9 | /backup/user_340/ch79_2020_04_08_17_16_37_430613.py | 3692e00bb61b220fb835ac8e529d71a5ac2851ad | [] | no_license | gabriellaec/desoft-analise-exercicios | b77c6999424c5ce7e44086a12589a0ad43d6adca | 01940ab0897aa6005764fc220b900e4d6161d36b | refs/heads/main | 2023-01-31T17:19:42.050628 | 2020-12-16T05:21:31 | 2020-12-16T05:21:31 | 306,735,108 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 133 | py | def monta_dicionario(lista1, lista2):
dicionario={}
for i in range(len(lista1)):
dicionario[lista1[i]]=lista2[i]
| [
"you@example.com"
] | you@example.com |
ff93f81a89b9f25fa80f463b60f894e744aea0dd | 69a36ca23409b994a31759bad58971b197cad236 | /config/settings.py | 3445021fab5cfbc2c6ca87cdbd98f719463686c2 | [] | no_license | matt700395/awesome_repo | 56601cf817106df0e210e78c7bb1f11af1e60c3a | d49b1e55b6ade24f1f2058319ac6859b45e511bc | refs/heads/master | 2023-08-27T16:45:15.570115 | 2021-11-11T14:16:06 | 2021-11-11T14:16:06 | 427,026,282 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 3,346 | py | """
Django settings for config project.
Generated by 'django-admin startproject' using Django 3.0.
For more information on this file, see
https://docs.djangoproject.com/en/3.0/topics/settings/
For the full list of settings and their values, see
https://docs.djangoproject.com/en/3.0/ref/settings/
"""
import os
# Bu... | [
"matt7003@korea.ac.kr"
] | matt7003@korea.ac.kr |
c474ddcdc642369145b11ba23644182f63331500 | 116a4a2fcd3e9c3d216f96103006c707daa6001a | /HelloDjango/apps/awards/migrations/0017_auto_20200726_0254.py | 1dccd60f9a05a0237dcea616506c43eae765cb60 | [] | no_license | Eldar1988/a_white_birds | 22d743ed1fa651062f070c0e81b7ac665be7a72a | 0430d5322b3a55b6f55e9541675d6670f5d8a518 | refs/heads/master | 2022-12-18T20:23:26.293059 | 2020-09-15T04:27:59 | 2020-09-15T04:27:59 | 283,169,602 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,212 | py | # Generated by Django 3.0.6 on 2020-07-25 20:54
from django.db import migrations, models
class Migration(migrations.Migration):
dependencies = [
('awards', '0016_juryapproved_project'),
]
operations = [
migrations.RemoveField(
model_name='jury',
name='user',
... | [
"elfarych@gmail.com"
] | elfarych@gmail.com |
ec6e3a87299b3f0b27c39ebb22357a57cd9e2f35 | 04afb34356de112445c3e5733fd2b773d92372ef | /Sem1/FP/S13/venv/Scripts/pip-script.py | ecfdd60747e705166efa7dda1830c8ac7fb753a9 | [] | no_license | AndreeaCimpean/Uni | a4e48e5e1dcecbc0c28ad45ddd3b0989ff7985c8 | 27df09339e4f8141be3c22ae93c4c063ffd2b172 | refs/heads/master | 2020-08-21T19:12:49.840044 | 2020-05-15T17:22:50 | 2020-05-15T17:22:50 | 216,222,647 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 405 | py | #!D:\Facultate\UniRepo\Sem1\FP\S13\venv\Scripts\python.exe
# EASY-INSTALL-ENTRY-SCRIPT: 'pip==19.0.3','console_scripts','pip'
__requires__ = 'pip==19.0.3'
import re
import sys
from pkg_resources import load_entry_point
if __name__ == '__main__':
sys.argv[0] = re.sub(r'(-script\.pyw?|\.exe)?$', '', sys.argv[0])
... | [
"andreeacimpean.910@gmail.com"
] | andreeacimpean.910@gmail.com |
07ee5ca8244bc40fdcfdffc0e184e8d66225d837 | 91d13f45f8527c368ebc6e44c75142a043f0583b | /test_zappa_cookiecutter/users/tests/test_drf_urls.py | 5c5a28e94cb0566c442fdcd429e5dbf1a914a39c | [
"MIT"
] | permissive | Andrew-Chen-Wang/cookiecutter-django-lambda | 6beed03d82eeecf95281c7f03a279c9c8b2ca85c | c4c64e174f653205c399ffa683918141f2f058d7 | refs/heads/master | 2022-11-16T12:20:00.589856 | 2020-07-19T20:19:41 | 2020-07-19T20:19:41 | 280,943,511 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 676 | py | import pytest
from django.urls import resolve, reverse
from test_zappa_cookiecutter.users.models import User
pytestmark = pytest.mark.django_db
def test_user_detail(user: User):
assert (
reverse("api:user-detail", kwargs={"username": user.username})
== f"/api/users/{user.username}/"
)
as... | [
"acwangpython@gmail.com"
] | acwangpython@gmail.com |
221eabeb7855ab26b445ce0626620cf82ea4dd10 | 781e2692049e87a4256320c76e82a19be257a05d | /all_data/exercism_data/python/series/a713022194c640d79ae14ee2e504dd88.py | eb7a127a4563a635852c50f164844820a748ca91 | [] | no_license | itsolutionscorp/AutoStyle-Clustering | 54bde86fe6dbad35b568b38cfcb14c5ffaab51b0 | be0e2f635a7558f56c61bc0b36c6146b01d1e6e6 | refs/heads/master | 2020-12-11T07:27:19.291038 | 2016-03-16T03:18:00 | 2016-03-16T03:18:42 | 59,454,921 | 4 | 0 | null | 2016-05-23T05:40:56 | 2016-05-23T05:40:56 | null | UTF-8 | Python | false | false | 221 | py | def slices( N, size ):
if (size == 0 and len(N) > 0) or (len(N) < size):
raise ValueError('Bad input!')
return [ [ int(d) for d in N[s:s+size] ]
for s in range( len(N) - size + 1 ) ]
| [
"rrc@berkeley.edu"
] | rrc@berkeley.edu |
deca411428980e2f3479946e16bec2cf5d7bc3c3 | 516932b326f58f9dc7c008e379f80cafd820acc0 | /src/helixtariff/test/logic/test_user_tariff.py | efde456f49fbfc657f1b000a05a4043a1fc4b16b | [] | no_license | sand8080/helixtariff | ffa4021fac16876bbbad8a4a8f1c53a9e4fd71d7 | 0bb56ad9e954509961db6bf636bce3a541709b93 | refs/heads/master | 2020-12-24T14:57:01.276045 | 2012-07-12T14:59:56 | 2012-07-12T14:59:56 | 1,605,281 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,923 | py | import unittest
from helixcore.error import RequestProcessingError
from helixtariff.test.logic.actor_logic_test import ActorLogicTestCase
class UserTariffTestCase(ActorLogicTestCase):
u_id = 22
def test_add_user_tariff(self):
t_id = self._add_tariff('tariff one', currency='RUB')
self._add_u... | [
"sand8080@gmail.com"
] | sand8080@gmail.com |
0e512d5cc3c40a98f88773bb04257a5009284703 | a8062308fb3bf6c8952257504a50c3e97d801294 | /test/test_1680_concatenation_of_consecutive_binary_numbers.py | 2e973fa95d840dec8ee1b362d393d6690776c76f | [] | no_license | wan-catherine/Leetcode | 650d697a873ad23c0b64d08ad525bf9fcdb62b1b | 238995bd23c8a6c40c6035890e94baa2473d4bbc | refs/heads/master | 2023-09-01T00:56:27.677230 | 2023-08-31T00:49:31 | 2023-08-31T00:49:31 | 143,770,000 | 5 | 0 | null | null | null | null | UTF-8 | Python | false | false | 460 | py | from unittest import TestCase
from problems.N1680_Concatenation_Of_Consecutive_Binary_Numbers import Solution
class TestSolution(TestCase):
def test_concatenatedBinary(self):
self.assertEqual(1, Solution().concatenatedBinary(1))
def test_concatenatedBinary_1(self):
self.assertEqual(27, Solutio... | [
"rarry2012@gmail.com"
] | rarry2012@gmail.com |
c2f109d8653198c97abaf0506e538f09dafebf27 | a479a5773fd5607f96c3b84fed57733fe39c3dbb | /napalm_yang/models/openconfig/network_instances/network_instance/afts/aft/entries/entry/next_hops/next_hop/state/__init__.py | 9f9a949d618408cef24874b85b55dba45410a6d5 | [
"Apache-2.0"
] | permissive | napalm-automation/napalm-yang | 839c711e9294745534f5fbbe115e0100b645dbca | 9148e015b086ebe311c07deb92e168ea36fd7771 | refs/heads/develop | 2021-01-11T07:17:20.226734 | 2019-05-15T08:43:03 | 2019-05-15T08:43:03 | 69,226,025 | 65 | 64 | Apache-2.0 | 2019-05-15T08:43:24 | 2016-09-26T07:48:42 | Python | UTF-8 | Python | false | false | 136,581 | py | # -*- coding: utf-8 -*-
from operator import attrgetter
from pyangbind.lib.yangtypes import RestrictedPrecisionDecimalType
from pyangbind.lib.yangtypes import RestrictedClassType
from pyangbind.lib.yangtypes import TypedListType
from pyangbind.lib.yangtypes import YANGBool
from pyangbind.lib.yangtypes import YANGListTy... | [
"dbarrosop@dravetech.com"
] | dbarrosop@dravetech.com |
929c4b554d91766794b550e36a6c1d59d80404f6 | 2cfc228988a51857269edf2fe7b85c7f9a03e94b | /prysm/otf.py | f6583f6e4089a0dfd734bba53b56f1734431fde1 | [
"MIT"
] | permissive | fakahil/prysm | 93dd2523e6416afa2774435a6df796df8b7b6f37 | c6235043fae90540c392291051d454e8813d3884 | refs/heads/master | 2021-05-18T21:20:46.745298 | 2020-02-18T00:21:27 | 2020-02-18T00:21:27 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 12,626 | py | """A base optical transfer function interface."""
import warnings
from .conf import config
from .mathops import engine as e
from ._richdata import RichData
from .psf import PSF
from .fttools import forward_ft_unit
def transform_psf(psf, sample_spacing):
data = e.fft.fftshift(e.fft.fft2(e.fft.ifftshift(psf.data))... | [
"brandondube@gmail.com"
] | brandondube@gmail.com |
461aedd8d00d14d677bdaaa5d221d39e7bd1f887 | d7016f69993570a1c55974582cda899ff70907ec | /sdk/storage/azure-mgmt-storage/azure/mgmt/storage/v2021_04_01/aio/operations/_table_services_operations.py | a773278f633a42e0385983cffb93ca8fbcf3224b | [
"LicenseRef-scancode-generic-cla",
"MIT",
"LGPL-2.1-or-later"
] | permissive | kurtzeborn/azure-sdk-for-python | 51ca636ad26ca51bc0c9e6865332781787e6f882 | b23e71b289c71f179b9cf9b8c75b1922833a542a | refs/heads/main | 2023-03-21T14:19:50.299852 | 2023-02-15T13:30:47 | 2023-02-15T13:30:47 | 157,927,277 | 0 | 0 | MIT | 2022-07-19T08:05:23 | 2018-11-16T22:15:30 | Python | UTF-8 | Python | false | false | 17,622 | py | # pylint: disable=too-many-lines
# coding=utf-8
# --------------------------------------------------------------------------
# Copyright (c) Microsoft Corporation. All rights reserved.
# Licensed under the MIT License. See License.txt in the project root for license information.
# Code generated by Microsoft (R) AutoRe... | [
"noreply@github.com"
] | kurtzeborn.noreply@github.com |
6c3f3138f5a174c373d308b7a48067eb2479d0e0 | c208954de92470c0144fad2e07a92ed1822edd59 | /selenia/out_dis.py | 183b10d388d465444ad227f3c3a25273230c321e | [
"MIT"
] | permissive | rendy026/reverse-enginnering | 4217f3b723569fb792bac0f22a56a305199db1dc | f04cec0bf518a2617fc4fd7155f755fafc2af799 | refs/heads/master | 2023-01-07T15:49:15.791052 | 2020-10-13T09:22:02 | 2020-10-13T09:22:02 | 303,575,571 | 0 | 0 | MIT | 2020-10-13T09:41:59 | 2020-10-13T03:17:42 | Python | UTF-8 | Python | false | false | 67,675 | py | # FileNames : <EzzKun>
# Python Bytecode : 3.8.5
# Selector <module> In Line 1 file out.pyc
# Timestamp In Code : (2020-09-18 18:10:25)
# Method Name: <module>
# Filename: <EzzKun>
# Argument count: 0
# Kw-only arguments: 0
# Number of locals: 0
# Stack size: 10
# Flags: 0x000000... | [
"noreply@github.com"
] | rendy026.noreply@github.com |
20a59d30363f13db08a271bd7d4156a4795b5037 | 9fa71d5834dae1c8900b3444f564b11326374d36 | /packages/ipm_cloud_postgresql/folha/rotinas_envio/tipo-afastamento.py | 81f76c9ccfb467f9f87b432e8845eb17d8d9c18f | [] | no_license | JoaoPauloLeal/toolbox | a85e726cfeb74603cb64d73c4af64757a9a60db7 | 924c063ba81395aeddc039a51f8365c02e527963 | refs/heads/master | 2023-06-07T02:17:42.069985 | 2021-06-28T19:06:40 | 2021-06-28T19:06:40 | 381,128,045 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 4,411 | py | import packages.ipm_cloud_postgresql.model as model
import bth.interacao_cloud as interacao_cloud
import json
import logging
from datetime import datetime
tipo_registro = 'tipo-afastamento'
sistema = 300
limite_lote = 500
url = "https://pessoal.cloud.betha.com.br/service-layer/v1/api/tipo-afastamento"
def iniciar_pr... | [
"joao.leal@betha.com.br"
] | joao.leal@betha.com.br |
c3a9262abc44ac5508726e238bdcacc3f8454599 | 24cee07743790afde5040c38ef95bb940451e2f6 | /acode/abc284/e/update.py | cbe323dede2e63602d87336c493cc58525a7c3eb | [] | no_license | tinaba96/coding | fe903fb8740d115cf5a7f4ff5af73c7d16b9bce1 | d999bf5620e52fabce4e564c73b9f186e493b070 | refs/heads/master | 2023-09-01T02:24:33.476364 | 2023-08-30T15:01:47 | 2023-08-30T15:01:47 | 227,594,153 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 6,006 | py | import sys
sys.setrecursionlimit(500005)
#sys.setrecursionlimit(10**9)
#import pypyjit # this is for solving slow issue for pypy when using recursion but python will not need this (test will fail but submit works)
#pypyjit.set_param('max_unroll_recursion=-1')
N, M = list(map(int, input().split()))
mp = [[] for n in r... | [
"tinaba178.96@gmail.com"
] | tinaba178.96@gmail.com |
00e61e3359148ae5195cff96ee8a1f87917fa3ba | 6f05f7d5a67b6bb87956a22b988067ec772ba966 | /data/test/python/e0a24819976e888969becc8f9ec8d2f0e7e377efurls.py | e0a24819976e888969becc8f9ec8d2f0e7e377ef | [
"MIT"
] | permissive | harshp8l/deep-learning-lang-detection | 93b6d24a38081597c610ecf9b1f3b92c7d669be5 | 2a54293181c1c2b1a2b840ddee4d4d80177efb33 | refs/heads/master | 2020-04-07T18:07:00.697994 | 2018-11-29T23:21:23 | 2018-11-29T23:21:23 | 158,597,498 | 0 | 0 | MIT | 2018-11-21T19:36:42 | 2018-11-21T19:36:41 | null | UTF-8 | Python | false | false | 591 | py | #coding:utf-8
from controller.index import Index
from controller.article import Article
from controller.signin import Signin
from controller.write import Write
from controller.signout import Signout
from controller.page import About,Type
from controller.api import Article as ART,Comment as com
urls = [
#首页
(r'/', In... | [
"aliostad+github@gmail.com"
] | aliostad+github@gmail.com |
626c922de9219080952e7221d26a8a4a2740ad29 | 6e8b606bca1eaddd8858fffc0fdeda039a438af5 | /source/precipitation/precip_stats_for_central_arctic_to_timeseries.py | 3af2eff5c86951f4471ed3fd8fddbaeec12bb877 | [] | no_license | andypbarrett/SnowOnSeaIce | 1f93a0523933fff0bfdd89fc87ad32b371bae359 | b8fe84a23bf790eb8efc43f4b89725fb7ba7d73c | refs/heads/master | 2023-01-20T11:53:30.835890 | 2023-01-18T17:43:19 | 2023-01-18T17:43:19 | 137,275,118 | 0 | 1 | null | null | null | null | UTF-8 | Python | false | false | 1,836 | py | #----------------------------------------------------------------------
# Calculates mean of precipitation stats for Arctic Ocean excluding
# Barents and Kara seas. This region conforms to the regions with
# data from the NP drifting stations.
#----------------------------------------------------------------------
im... | [
"apbarret@nsidc.org"
] | apbarret@nsidc.org |
b586bc73c8abf2ab0858af5c05cb97731f7d31fa | a366db0f2a117e0a8cf923e9b4de5c643155e047 | /bench/state.py | 08dad6e8fdc6e4fca68111ef1035197012e312ac | [] | no_license | genome/nessy-server | d2ff6aa7bb692f50e5cabb435a380670be75b2b9 | f8207310d33bf259130df806b4d759ef1a883e56 | refs/heads/master | 2021-01-10T18:59:38.910186 | 2014-12-29T22:11:16 | 2014-12-29T22:11:16 | 15,785,645 | 0 | 0 | null | 2014-12-29T22:11:16 | 2014-01-10T01:57:38 | Python | UTF-8 | Python | false | false | 2,115 | py | import collections
import datetime
class State(object):
UNSET = object()
def __init__(self, resource_names):
self._state_index = collections.defaultdict(set)
self._state_index['released'].update(resource_names)
self._resource_index = {r: 'released' for r in resource_names}
s... | [
"mark.m.burnett@gmail.com"
] | mark.m.burnett@gmail.com |
fad0a9d402c2a9c652ef1ffc6eb8328b5bf559c7 | 5257652fc34ec87fe45d390ba49b15b238860104 | /nn_interpretation/nn_unique/get_nn_unique.py | 0aefadbf1cc44379399634748c270b52f7fc9a45 | [] | no_license | thekingofall/alzheimers_parkinsons | cd247fa2520c989e8dd853ed22b58a9bff564391 | 4ceae6ea3eb4c58919ff41aed8803855bca240c8 | refs/heads/master | 2022-11-30T22:36:37.201334 | 2020-08-12T01:23:55 | 2020-08-12T01:23:55 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 233 | py | buddies_nn=set(open('buddies_nn.txt','r').read().strip().split('\n'))
sig_svm=set(open('sig_svm.txt','r').read().strip().split('\n'))
nn_unique=buddies_nn-sig_svm
outf=open('nn_unique.txt','w')
outf.write('\n'.join(nn_unique)+'\n')
| [
"annashcherbina@gmail.com"
] | annashcherbina@gmail.com |
392775843ef9a141cf72d2566d5ca45de26aa634 | 5aa27e52058d014bf4fb784d63a70c7d1f565330 | /Games/Tanks.py | 49cfe3c4acab326b37343a174e0e53d14d9bffe0 | [] | no_license | a5vh/AdPro | 2e5c5f952bb917d3b98c277a512670b67ce0718f | 595c1c3e5088ae3cfb85078282dffceb44c1901e | refs/heads/master | 2020-04-11T00:16:37.088549 | 2019-05-05T19:24:53 | 2019-05-05T19:24:53 | 161,381,037 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 10,458 | py | import sys, time, random, math, pygame
from pygame.locals import *
from MyLibrary import *
class Bullet():
def __init__(self,position):
self.alive = True
self.color = (250,20,20)
self.position = Point(position.x,position.y)
self.velocity = Point(0,0)
self.rect = Rect(0,0,4,... | [
"august.hummert5@gmail.com"
] | august.hummert5@gmail.com |
184bfebb357383b520e0be4fda111faf8a4b9ffa | e4fcd551a9d83e37a2cd6d5a2b53a3cc397ccb10 | /codes/eval_metrics/writing/mmocr/tools/dataset_converters/textdet/synthtext_converter.py | 811b1cc0e669b8dd185dbcf8156595002713a850 | [
"Apache-2.0"
] | permissive | eslambakr/HRS_benchmark | 20f32458a47c6e1032285b44e70cf041a64f842c | 9f153d8c71d1119e4b5c926b899bb556a6eb8a59 | refs/heads/main | 2023-08-08T11:57:26.094578 | 2023-07-22T12:24:51 | 2023-07-22T12:24:51 | 597,550,499 | 33 | 0 | null | null | null | null | UTF-8 | Python | false | false | 6,177 | py | # Copyright (c) OpenMMLab. All rights reserved.
import argparse
import json
import os.path as osp
import time
import lmdb
import mmcv
import mmengine
import numpy as np
from scipy.io import loadmat
from shapely.geometry import Polygon
from mmocr.utils import check_argument
def trace_boundary(char_boxes):
"""Tra... | [
"islam.bakr.2017@gmail.com"
] | islam.bakr.2017@gmail.com |
dba9826fd017a5155e4aeb88ce6828001cac6adb | f4a4c9a68a4ead50c0882832f3f73b9cb29271f6 | /backend/cardgameapp_22189/settings.py | 5d1e2e15e8ab4ff8efd7b0549a39e0e1e23558cb | [] | no_license | crowdbotics-apps/cardgameapp-22189 | 276e0c18661a3e1ae474f2deb11b6fc32b66eb38 | 200ca6880781d3d832be39f44b8aa290db481ec2 | refs/heads/master | 2023-01-11T11:45:35.488695 | 2020-11-01T17:50:20 | 2020-11-01T17:50:20 | 309,153,974 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 6,111 | py | """
Django settings for cardgameapp_22189 project.
Generated by 'django-admin startproject' using Django 2.2.2.
For more information on this file, see
https://docs.djangoproject.com/en/2.2/topics/settings/
For the full list of settings and their values, see
https://docs.djangoproject.com/en/2.2/ref/settings/
"""
im... | [
"team@crowdbotics.com"
] | team@crowdbotics.com |
cf025e4e4a83d5bcf74a7018aca2af88294b8cb1 | ec645951ce4a1f7d404ebca438dfff8fb74cc3f4 | /venv/bin/jupyter-troubleshoot | 8f347cbe928d8562e8843ae244df1a6cae1c7e4f | [] | no_license | Josue23/scrapy | 695c0e93e6c1f0c0de5a04bd2eaced3e5520801e | 469cc4cff7d986264c4bcc291e9eb5f5a6256da9 | refs/heads/master | 2021-01-09T06:19:59.794012 | 2017-03-04T00:21:52 | 2017-03-04T00:21:52 | 80,957,631 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 264 | #!/home/josh/Documentos/labs/scrapy/venv/bin/python3.5
# -*- coding: utf-8 -*-
import re
import sys
from jupyter_core.troubleshoot import main
if __name__ == '__main__':
sys.argv[0] = re.sub(r'(-script\.pyw?|\.exe)?$', '', sys.argv[0])
sys.exit(main())
| [
"josuerodrigues@gmail.com"
] | josuerodrigues@gmail.com | |
e1286fa2a637e5aa1f0465a38d82e1bd3905c8d1 | 659a7a65c877f2eb0adbb6001a1f85f063d01acd | /mscreen/autodocktools_prepare_py3k/AutoDockTools/VisionInterface/Adt/Input/PublicServerLigandDB.py | 26991dad68bfc2d248eec6fec64dacb18f2d6a6b | [
"MIT"
] | permissive | e-mayo/mscreen | da59771be250ebe341feb102e0cbf41aab70de43 | a50f0b2f7104007c730baa51b4ec65c891008c47 | refs/heads/main | 2023-06-21T17:47:06.519307 | 2021-08-09T16:06:29 | 2021-08-09T16:06:29 | 345,008,321 | 10 | 1 | null | null | null | null | UTF-8 | Python | false | false | 3,110 | py | #########################################################################
#
# Date: Nov 2001 Authors: Michel Sanner
#
# sanner@scripps.edu
#
# The Scripps Research Institute (TSRI)
# Molecular Graphics Lab
# La Jolla, CA 92037, USA
#
# Copyright: Michel Sanner and TSRI
#
###########################... | [
"eduardomayoyanes@gmail.com"
] | eduardomayoyanes@gmail.com |
a625b979deaf6a06f61b88dd43ac56027f5f5322 | c59d6587ed5d7e7c4f4cbad2e4c8188eee741ad9 | /conftest.py | 134e36c3a4f3b5465cce6e8c54ef587ba3565484 | [] | no_license | n1k0din/kekino-api | 921d83b1be0c50e7dfb0b2411ba63fd9f3dc8039 | 4fef4b1c6bdec970fae1b599be4c719eee06e999 | refs/heads/master | 2023-08-27T18:21:16.640031 | 2021-11-07T11:13:01 | 2021-11-07T11:13:01 | 425,223,294 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 228 | py | import pytest
from django.conf import settings
@pytest.fixture(scope='session')
def django_db_setup():
settings.DATABASES['default'] = {
'ENGINE': 'django.db.backends.sqlite3',
'NAME': 'db.sqlite3',
}
| [
"nik726@gmail.com"
] | nik726@gmail.com |
d564c8aa72b8618e3d89a78ea6866c695c94cd74 | 7462f315c3f011f50dc0d1ce89cf3d5f2eb024db | /tramp/likelihoods/abs_likelihood.py | 8ad31af49a0340c934ae371dcc2c870f70851570 | [
"MIT"
] | permissive | Artaxerces/tramp | 060bcceb50f59ad5de96ab4eba8aa322651d90cf | e5351e65676f2e9a1b90d0f4eaf11d8259b548ef | refs/heads/master | 2023-04-03T04:49:14.345162 | 2021-04-08T08:55:54 | 2021-04-08T08:55:54 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,252 | py | import numpy as np
from scipy.stats import norm
from .base_likelihood import Likelihood
from ..utils.integration import gaussian_measure_2d
class AbsLikelihood(Likelihood):
def __init__(self, y, y_name="y"):
self.y_name = y_name
self.size = self.get_size(y)
self.repr_init()
self.y ... | [
"antoine.baker59@gmail.com"
] | antoine.baker59@gmail.com |
f357eb496bccb34a809712c97c9517ac6f0fdd70 | 8ed3d2d285bb7255209b56a5ff9ec83bb4b8f430 | /setup.py | 6a083b3b06d7ee5d3ed16d73aacfe015edf07f6e | [] | no_license | MarkLuro/requests-html | f4af9211353e09908f254a9edc0965c084c59a36 | f43f3241f0c63cd50bb4286edffcc1f8ee5ae7bd | refs/heads/master | 2021-01-24T02:11:25.628019 | 2018-02-25T13:23:40 | 2018-02-25T13:23:40 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 3,023 | py | #!/usr/bin/env python
# -*- coding: utf-8 -*-
# Note: To use the 'upload' functionality of this file, you must:
# $ pip install twine
import io
import os
import sys
from shutil import rmtree
from setuptools import find_packages, setup, Command
# Package meta-data.
NAME = 'requests-html'
DESCRIPTION = 'HTML Parsin... | [
"me@kennethreitz.org"
] | me@kennethreitz.org |
233da41e7bd6d8bc26423d834ec30979432da47b | 77f65ea86ebc544c3f3e66c0152086e45669068c | /ch09-objects/e42b2_recent_dict.py | 6449ace10c6bb5805d30a84d5cf9f40f10adaedd | [] | no_license | Cptgreenjeans/python-workout | e403f48b0694ff4db32fe5fc3f87f02f48a1a68e | b9c68520d572bf70eff8e554a8ee9c8702c88e6e | refs/heads/master | 2023-07-16T21:49:14.198660 | 2021-08-29T13:49:12 | 2021-08-29T13:49:12 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 374 | py | #!/usr/bin/env python3
"""Solution to chapter 9, exercise 42, beyond 2: recent_dict"""
class RecentDict(dict):
def __init__(self, maxsize):
super().__init__()
self.maxsize = maxsize
def __setitem__(self, key, value):
dict.__setitem__(self, str(key), value)
if len(self) > sel... | [
"reuven@lerner.co.il"
] | reuven@lerner.co.il |
d1d8b0f0745d0cbadc0870e6c03600d69579d87f | 52b5773617a1b972a905de4d692540d26ff74926 | /.history/coins_20200607123443.py | 742c4c7e6e1d456cb4ac4cfeb1fabd621a8f9488 | [] | no_license | MaryanneNjeri/pythonModules | 56f54bf098ae58ea069bf33f11ae94fa8eedcabc | f4e56b1e4dda2349267af634a46f6b9df6686020 | refs/heads/master | 2022-12-16T02:59:19.896129 | 2020-09-11T12:05:22 | 2020-09-11T12:05:22 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 115 | py |
def change(amount,coins):
count = 0
for i in range(len(coins)):
if mount
change(5,[1,2,5])
| [
"mary.jereh@gmail.com"
] | mary.jereh@gmail.com |
c53ec5397ec182007a22d88243b2d4ec32a3f966 | d6ca0b326f1bd0ce381c6db611f6331096bf4187 | /examples/example_20_using_deap_manual_runs.py | ab46bba8dfec0020018669d017e35953cbda71ea | [
"BSD-3-Clause"
] | permissive | SmokinCaterpillar/pypet | aa35355d70e8f44be015313494376d993f645d80 | 3d454ac65f89e7833baaf89510f73c546e90d8f6 | refs/heads/develop | 2023-08-08T16:01:54.087819 | 2023-02-14T14:59:32 | 2023-02-14T14:59:32 | 12,901,526 | 89 | 22 | BSD-3-Clause | 2023-07-24T00:46:12 | 2013-09-17T17:06:00 | Python | UTF-8 | Python | false | false | 6,723 | py | """ An example showing how to use DEAP optimization (http://pythonhosted.org/deap/).
DEAP can be combined with *pypet* to keep track of all the data and the full trajectory
of points created by a genetic algorithm.
Note that *pypet* adds quite some overhead to the optimization algorithm.
Using *pypet* in combination ... | [
"robert.meyer@ni.tu-berlin.de"
] | robert.meyer@ni.tu-berlin.de |
eb7ea1fa5ef9b6d3b9b41c49fb051d256edeeb0e | 41fd80f9ccc72a17c2db16b7019312a87d3181e8 | /zhang_local/pdep/network3396_1.py | cf88478cfa806d77eb44abbf591e5dc37db88509 | [] | no_license | aberdeendinius/n-heptane | 1510e6704d87283043357aec36317fdb4a2a0c34 | 1806622607f74495477ef3fd772908d94cff04d9 | refs/heads/master | 2020-05-26T02:06:49.084015 | 2019-07-01T15:12:44 | 2019-07-01T15:12:44 | 188,069,618 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 117,871 | py | species(
label = '[CH2]C=COC([CH2])[O](6739)',
structure = SMILES('[CH2]C=COC([CH2])[O]'),
E0 = (167.03,'kJ/mol'),
modes = [
HarmonicOscillator(frequencies=([3000,3033.33,3066.67,3100,415,465,780,850,1435,1475,900,1100,1380,1390,370,380,2900,435,2995,3025,975,1000,1300,1375,400,500,1630,1680,345... | [
"dinius.ab@husky.neu.edu"
] | dinius.ab@husky.neu.edu |
a607cfd0c82f0951367c489f47dad4d25eb49d58 | 00829e1ff78f73dab073a201d68139960c1d1922 | /tools/toolset/tool/rigging/pipline_tool/ui/his/ui_create_character.py | 42c99cc1874dedb0e213f77abca01d3414e1a31e | [] | no_license | liangyongg/Beam_Tools | a021ceb4187107508536c46726da5b9629ffd1cf | 21b5d06e660f058434e589ae4f672f96296b7540 | refs/heads/master | 2018-11-04T04:43:02.523654 | 2018-08-26T12:33:09 | 2018-08-26T12:33:09 | 115,005,481 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,908 | py | # -*- coding: utf-8 -*-
# Form implementation generated from reading ui file 'ui_create_character.ui'
#
# Created: Thu Apr 26 11:29:46 2018
# by: pyside-uic 0.2.15 running on PySide 1.2.4
#
# WARNING! All changes made in this file will be lost!
from PySide import QtCore, QtGui
class Ui_Form(object):
def set... | [
"hhhh"
] | hhhh |
ce74a238c917af6de5cfc93964163002750f06d8 | 59de7788673ade984b9c9fbc33664a7cbdba67d3 | /res/scripts/client_common/shared_utils/__init__.py | 9b417b171ce7cf3e50a53c5b6006973b705af2f6 | [] | no_license | webiumsk/WOT-0.9.15-CT | 3fa24ab37a6c91b7073034afb2f355efa5b7fe36 | fbd194fbaa6bdece51c7a68fc35bbb5257948341 | refs/heads/master | 2020-12-24T21:27:23.175774 | 2016-05-01T13:47:44 | 2016-05-01T13:47:44 | 57,600,180 | 0 | 0 | null | null | null | null | WINDOWS-1250 | Python | false | false | 4,366 | py | # 2016.05.01 15:25:53 Střední Evropa (letní čas)
# Embedded file name: scripts/client_common/shared_utils/__init__.py
import weakref
import itertools
import types
import BigWorld
from debug_utils import LOG_ERROR, LOG_WARNING
ScalarTypes = (types.IntType,
types.LongType,
types.FloatType,
types.BooleanType) + types.S... | [
"info@webium.sk"
] | info@webium.sk |
4cec80ef5706409c00bd637115c1cd8fac68858c | aab3df1e96ef417a6f85837eca1d640b787e1276 | /sklearn_porter/estimator/classifier/KNeighborsClassifier/__init__.py | 401a6844995e4c7e01075a246cbf79d7bff3a43d | [
"MIT"
] | permissive | apasanen/sklearn-porter | 88634b6f4985e1cd1ee09869495a8a3a3f6c1134 | 43a403c45c7538876df5dbe3c2f79e4aca965d47 | refs/heads/master | 2020-04-10T21:28:19.501112 | 2018-12-11T08:39:40 | 2018-12-11T09:21:05 | 161,297,343 | 0 | 0 | MIT | 2018-12-11T07:52:21 | 2018-12-11T07:52:21 | null | UTF-8 | Python | false | false | 8,456 | py | # -*- coding: utf-8 -*-
import os
import json
from json import encoder
from sklearn_porter.estimator.classifier.Classifier import Classifier
class KNeighborsClassifier(Classifier):
"""
See also
--------
sklearn.neighbors.KNeighborsClassifier
http://scikit-learn.org/stable/modules/generated/
... | [
"darius.morawiec@nok.onl"
] | darius.morawiec@nok.onl |
01bc8dd81cafcbbf52dd9b8525c0fd40f828b6f4 | 274521d5ccfbaebb97cdfbfa340d951eee7c9efa | /Python/PythonProgrammingLanguage/Encapsulation/encap_env/bin/jsonschema | 116515a0218c94456db568d63ab738fffe5c5f5e | [
"MIT"
] | permissive | nitin-cherian/LifeLongLearning | ef8e1ed61e4bf8b6ae4a0ae642c559ab47be84b4 | 84084792058358365162c645742c70064a2d5fd6 | refs/heads/master | 2021-01-21T10:38:41.797326 | 2018-08-23T01:28:10 | 2018-08-23T01:28:10 | 91,701,351 | 6 | 0 | null | null | null | null | UTF-8 | Python | false | false | 323 | #!/home/nitin/Learn/Repositories/Github/LifeLongLearning/Python/PythonProgrammingLanguage/Encapsulation/encap_env/bin/python
# -*- coding: utf-8 -*-
import re
import sys
from jsonschema.cli import main
if __name__ == '__main__':
sys.argv[0] = re.sub(r'(-script\.pyw?|\.exe)?$', '', sys.argv[0])
sys.exit(main(... | [
"nitin.cherian@gmail.com"
] | nitin.cherian@gmail.com | |
76ba202c34534ea332d0d9c2b7c22175514cb943 | bf331831c2c532d76b91c11127cc4c76cf9f0031 | /166/D/ans_errorneous.py | eac398768204dd7b212a8fb9e6f37ee62331d50c | [] | no_license | mugenen/Codeforces-Solution | 519899d658a52dc87bfdba81110e9851ccf3b6de | f69874ad46acc511f4485dc29249f7010f562ea9 | refs/heads/master | 2021-01-22T04:49:48.986989 | 2013-02-25T12:36:10 | 2013-02-25T12:36:10 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,288 | py | import sys
import collections
import bisect
import math
class Trie:
class Node:
def __init__(self, x, bros = None, child = None):
self.data = x
self.bros = bros
self.child = child
def get_child(self, x):
child = self.child
while child:
... | [
"8monkey.theorem@gmail.com"
] | 8monkey.theorem@gmail.com |
627649476ff37a030466b373ef750b7e153b0eb0 | 498fcf34fa4482be5c9fefc488666e60edcf46c7 | /supervised_learning/0x01-classification/17-deep_neural_network.py~ | 90473c634dabec13840cc70707d19fee907312fb | [] | no_license | MansourKef/holbertonschool-machine_learning | 7dbc465def04c311c1afb0e8b8903cbe34c72ad3 | 19f78fc09f0ebeb9f27f3f76b98e7a0e9212fd22 | refs/heads/main | 2023-03-12T16:18:08.919099 | 2021-03-05T09:42:09 | 2021-03-05T09:42:09 | 317,303,125 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,201 | #!/usr/bin/env python3
"""module"""
import numpy as np
class DeepNeuralNetwork:
"""Deep Neural Network"""
def __init__(self, nx, layers):
"""Constructor"""
if not type(nx) is int:
raise TypeError("nx must be an integer")
if nx < 1:
raise ValueError("nx must be... | [
"2798@holbertonschool.com"
] | 2798@holbertonschool.com | |
0c98c3fa06970c85f3b2a81e02355551274fcf41 | 5b22437902bffa0f62b375d56bfb2b4485ef43f0 | /src/video_inpainting/padded_masked_video_tar_dataset.py | 93491de023c768894243ad89932a5aa1d0875600 | [
"MIT",
"CC-BY-SA-3.0",
"CC-BY-SA-4.0"
] | permissive | JohnsonzxChang/devil | eafa09f5258b4f33eda9564077814c6e63473a0f | 296115cd5f4952c7dc65bbcaaf2d1d5c55ef5d35 | refs/heads/public | 2023-07-03T12:07:58.917440 | 2021-08-10T00:06:38 | 2021-08-10T00:06:38 | 555,846,483 | 1 | 0 | MIT | 2022-10-22T13:22:43 | 2022-10-22T13:22:42 | null | UTF-8 | Python | false | false | 1,437 | py | import tarfile
from itertools import cycle
from .padded_masked_video_dataset import PaddedMaskedVideoDataset
class PaddedMaskedVideoTarDataset(PaddedMaskedVideoDataset):
def __init__(self, frames_dataset_path, masks_dataset_path):
self._frames_dataset_tar = tarfile.open(frames_dataset_path, 'r')
... | [
"szetor@umich.edu"
] | szetor@umich.edu |
6579e872948f51bf21e7c2ea85957dcf238da3da | 1b862f34c125ce200244dd79e4fda4b5b605ce2e | /.history/ML_T2_Validation_20210612133304.py | f4916063cc50283bddabf46d8c1a1f2ed57ad41b | [] | no_license | edwino26/CoreImages | 26085a49cf1cb79442ae563a88354b2fdceace87 | 6bf6e68cac8ab36c87b1e6ea702bfe6882b0f40e | refs/heads/master | 2023-06-22T12:53:37.344895 | 2021-07-21T04:31:44 | 2021-07-21T04:31:44 | 309,553,247 | 0 | 4 | null | 2021-04-29T23:23:15 | 2020-11-03T02:45:07 | Lasso | UTF-8 | Python | false | false | 9,517 | py | #T2 TEST DATA
# %%
import pandas as pd
import numpy as np
import matplotlib.pyplot as plt
import pickle
from scipy import interpolate
from scipy.integrate import simps
from numpy import trapz
from sklearn.metrics import mean_squared_error
# %%
#Load Stack
UVStack = pd.read_excel('./ML_Results/T2_test/ImgStack.xls')
I... | [
"ortega.edwin.y@gmail.com"
] | ortega.edwin.y@gmail.com |
dbe01cfd78374273c1c4be47f16e8c86a9962fcb | 13d222bc3332378d433835914da26ed16b583c8b | /src/pemjh/challenge52/main.py | b1407abc5c0d32694b4aaf0241a641dcaad75fcd | [] | no_license | mattjhussey/pemjh | c27a09bab09cd2ade31dc23fffac07374bea9366 | 2ebb0a525d2d1c0ee28e83fdc2638c2bec97ac99 | refs/heads/master | 2023-04-16T03:08:59.390698 | 2023-04-08T10:54:00 | 2023-04-08T10:54:00 | 204,912,926 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 681 | py | """ Challenge052 """
def get_sorted_string(unsorted):
"""
>>> get_sorted_string(54326)
'23456'
>>> get_sorted_string("aBayU")
'BUaay'
"""
return "".join(sorted(str(unsorted)))
def main():
""" challenge052 """
root = 0
found = False
while not found:
... | [
"matthew.hussey@googlemail.com"
] | matthew.hussey@googlemail.com |
fcf6d5b203f22c6e42690390171431383fde3627 | 9b328903c7ce1ddfc957c6db4a5fef265bce1dad | /preprocess.py | 2d04c659dfe88bfdce2082cc1a99285c36834611 | [] | no_license | matatabinoneko/viral_tweet_generation | 4a610b0327d7ce0e8e2b94eec0f82aa9f1c35ca1 | 1e26de293420dbed6f50f161b3210c9d14e3b2d4 | refs/heads/main | 2023-03-12T16:11:14.187622 | 2021-03-02T00:11:47 | 2021-03-02T00:11:47 | 330,305,509 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 4,466 | py | '''
ツイートの前処理を行う
'''
import argparse
import logzero
from logzero import logger
import logging
from os import path
from typing import List
from filtering_type import EmoticonFilter
import json
import MeCab
from collections import defaultdict
import re
logger.setLevel(logging.INFO)
mecabTagger = MeCab.Tagger("-Ochasen... | [
"matatabinoneko0721@gmail.com"
] | matatabinoneko0721@gmail.com |
caa4886993b2a6034b738129474f78353d70e2af | c427d9142df033af2b509412153dae35706ede61 | /recognition/pytorch_crnn/models/layers.py | fbaa09d9385382391ff58e1b8a380ebc4e74d249 | [] | no_license | brahimbellahcen/ocr_toolkit | 0b68776fe20b05f48807f856fffac752e3e08e66 | b4516d4193132eb48f821926dd6ef5d368f53899 | refs/heads/master | 2022-11-13T10:21:14.083497 | 2020-06-26T15:31:38 | 2020-06-26T15:31:38 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,032 | py | import torch
import torch.nn as nn
import torch.nn.functional as F
class blockCNN(nn.Module):
def __init__(self, in_nc, out_nc, kernel_size, padding, stride=1):
super(blockCNN, self).__init__()
self.in_nc = in_nc
self.out_nc = out_nc
self.kernel_size = kernel_size
self.padd... | [
"selcukcaglar08@gmail.com"
] | selcukcaglar08@gmail.com |
3e4af5c3428191b0f79157993cb4dc07ac9263b8 | bb983b38f9be7b6fd4ab1a651484db37c1aeff39 | /1122/my_library.py | 4e67830a25ee13ef2bb56196db5322f8047d4396 | [] | no_license | nakanishi-akitaka/python2018_backup | c214df78372cca993d69f8001010ec2f6dcaf1be | 45766d3c3777de2a91b3e2cf50c6bfedca8627da | refs/heads/master | 2023-02-18T08:04:28.625532 | 2022-06-07T01:02:53 | 2022-06-07T01:02:53 | 201,399,236 | 5 | 30 | null | 2023-02-10T21:06:51 | 2019-08-09T05:48:22 | Jupyter Notebook | UTF-8 | Python | false | false | 20,812 | py | # -*- coding: utf-8 -*-
"""
Created on Wed Aug 8 10:29:27 2018
@author: Akitaka
"""
import numpy as np
import matplotlib.pyplot as plt
from sklearn.metrics import mean_absolute_error
from sklearn.metrics import mean_squared_error
from sklearn.metrics import r2_score
from sklearn.model_selectio... | [
"noreply@github.com"
] | nakanishi-akitaka.noreply@github.com |
39aeb6e973594342d29c7e0c62856e9bdb055bea | e5ee4f343d9523129298e1cd989b52a142028cfe | /samples/contrib/azure-samples/databricks-pipelines/databricks_cluster_pipeline.py | 4cbd45e50b4cab9d62b7e153d21fb6660ecc37ea | [
"Apache-2.0"
] | permissive | joaoalvarenga/pipelines | 67c5b2c906134be8d4814a0851e4b60dfa4adf44 | 493c3d4e980b94a963a257247c6eb2d970b3dafa | refs/heads/master | 2020-12-08T18:22:52.433779 | 2020-01-10T05:00:34 | 2020-01-10T05:00:34 | 233,059,234 | 1 | 0 | Apache-2.0 | 2020-01-10T14:03:36 | 2020-01-10T14:03:35 | null | UTF-8 | Python | false | false | 1,780 | py | """Create a cluster in Databricks. Then submit a one-time Run to that cluster."""
import kfp.dsl as dsl
import kfp.compiler as compiler
import databricks
def create_cluster(cluster_name):
return databricks.CreateClusterOp(
name="createcluster",
cluster_name=cluster_name,
spark_version="5.3.... | [
"k8s-ci-robot@users.noreply.github.com"
] | k8s-ci-robot@users.noreply.github.com |
5b46996c84345b6406c48c03241e97ddfdbd1ac8 | d066f7fe739fb78f74ec2de8ccbfefdd4270f60f | /appimagebuilder/__init__.py | 5b4148a08e2776e617d6700c316eba5fc4629b93 | [
"MIT"
] | permissive | AppImageCrafters/appimage-builder | 666e75363a74f615cdb3673b3ca9d51a6d292a49 | f38699ef3644fa5409a5a262b7b6d99d6fb85db9 | refs/heads/main | 2023-08-17T06:34:54.029664 | 2023-06-03T17:51:04 | 2023-06-03T17:51:04 | 218,847,680 | 270 | 54 | MIT | 2023-09-06T17:04:18 | 2019-10-31T19:44:17 | Python | UTF-8 | Python | false | false | 651 | py | #!/usr/bin/env python3
# Copyright 2020 Alexis Lopez Zubieta
#
# Permission is hereby granted, free of charge, to any person obtaining a
# copy of this software and associated documentation files (the "Software"),
# to deal in the Software without restriction, including without limitation the
# rights to use, cop... | [
"contact@azubieta.net"
] | contact@azubieta.net |
15d2b575651bdea86b38c0e958fcaf83eaae4442 | 760fbf0e4675212a89dbba28ef771bf7ff7a0d91 | /Leetcode2019/145. 二叉树的后序遍历.py | 06d8fc7c4c1096758d26866d0f867745ac54876d | [] | no_license | chixujohnny/Leetcode | 1a420e318005140a2be036ab7c3fcd054b4ae011 | 3faa41556f13f45a08b49d4dcd371ed590f9cb14 | refs/heads/master | 2021-06-19T14:44:28.464335 | 2021-01-11T08:16:26 | 2021-01-11T08:16:26 | 155,142,704 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 563 | py | # coding: utf-8
# Definition for a binary tree node.
# class TreeNode(object):
# def __init__(self, x):
# self.val = x
# self.left = None
# self.right = None
class Solution(object):
def postorderTraversal(self, root):
"""
:type root: TreeNode
:rtype: List[int]
... | [
"1390463349@qq.com"
] | 1390463349@qq.com |
7dcbcaa847c475cb4d1f139f4cd8eb41abab09cb | 2f989d067213e7a1e19904d482a8f9c15590804c | /lib/python3.4/site-packages/django/contrib/contenttypes/apps.py | e5708adc99840e3b4a4bc3212d26d134a8462203 | [
"MIT"
] | permissive | levabd/smart4-portal | beb1cf8847134fdf169ab01c38eed7e874c66473 | 2c18ba593ce7e9a1e17c3559e6343a14a13ab88c | refs/heads/master | 2023-02-18T05:49:40.612697 | 2022-08-02T09:35:34 | 2022-08-02T09:35:34 | 116,001,098 | 0 | 1 | MIT | 2023-02-15T21:34:01 | 2018-01-02T10:00:07 | Roff | UTF-8 | Python | false | false | 693 | py | from django.apps import AppConfig
from django.contrib.contenttypes.checks import check_generic_foreign_keys
from django.core import checks
from django.db.models.signals import post_migrate, pre_migrate
from django.utils.translation import ugettext_lazy as _
from .management import (
inject_rename_contenttypes_oper... | [
"levabd@gmail.com"
] | levabd@gmail.com |
59e22f98d350ea5b45fcfb9fc47ea110043bdec0 | 9556f7e1d81a305d71a66b9768eba199e396d733 | /Thread/venv/bin/pip | 698fcef12df25482e9901a7aecb433703142f6b8 | [] | no_license | gitgaoqian/Python | 301a2823b50ec754a2c1a3f47c39ae8b0b8e6890 | 164f5271044b235d256a9bbe0a34caacf1e81fc8 | refs/heads/master | 2023-01-08T21:23:59.640828 | 2020-11-01T13:06:21 | 2020-11-01T13:06:21 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 394 | #!/home/ros/pycharm/MyFiles/thread/venv/bin/python
# EASY-INSTALL-ENTRY-SCRIPT: 'pip==9.0.1','console_scripts','pip'
__requires__ = 'pip==9.0.1'
import re
import sys
from pkg_resources import load_entry_point
if __name__ == '__main__':
sys.argv[0] = re.sub(r'(-script\.pyw?|\.exe)?$', '', sys.argv[0])
sys.exit(... | [
"734756851@qq.com"
] | 734756851@qq.com | |
61d841a540a06f74ec8d73ed015cc090e6283cd5 | 55c250525bd7198ac905b1f2f86d16a44f73e03a | /Python/Apps/Riddle Game App/temp.py | f841eb3bfa477531b1280da74ffd298624106bfc | [] | no_license | NateWeiler/Resources | 213d18ba86f7cc9d845741b8571b9e2c2c6be916 | bd4a8a82a3e83a381c97d19e5df42cbababfc66c | refs/heads/master | 2023-09-03T17:50:31.937137 | 2023-08-28T23:50:57 | 2023-08-28T23:50:57 | 267,368,545 | 2 | 1 | null | 2022-09-08T15:20:18 | 2020-05-27T16:18:17 | null | UTF-8 | Python | false | false | 127 | py | version https://git-lfs.github.com/spec/v1
oid sha256:dfddd312c5f04ffd65ec672ab6d6d80e68a8e6e69b98e472123679a87dc1e254
size 52
| [
"nateweiler84@gmail.com"
] | nateweiler84@gmail.com |
01b2be76c7a39b05d6db36b19dba8018456848d3 | 53fab060fa262e5d5026e0807d93c75fb81e67b9 | /backup/user_125/ch22_2020_03_02_20_28_19_768242.py | 6c3da9295a0c587ec5b4d1b65f83ce4882ba77e4 | [] | no_license | gabriellaec/desoft-analise-exercicios | b77c6999424c5ce7e44086a12589a0ad43d6adca | 01940ab0897aa6005764fc220b900e4d6161d36b | refs/heads/main | 2023-01-31T17:19:42.050628 | 2020-12-16T05:21:31 | 2020-12-16T05:21:31 | 306,735,108 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 143 | py | dias = int(input('quantos cigarros voce fuma por dia ? '))
anos = int(input('há quantos anos voce fuma?' ))
print ((anos*365*24*60)*dias*144) | [
"you@example.com"
] | you@example.com |
dba2f8e1a2489ee8595497efbce2fbe54822fbb2 | c8a04384030c3af88a8e16de4cedc4ef8aebfae5 | /stubs/pandas/tests/indexes/test_setops.pyi | 3493fb22582660788efeadee60d6a7bc60cb4307 | [
"MIT"
] | permissive | Accern/accern-xyme | f61fce4b426262b4f67c722e563bb4297cfc4235 | 6ed6c52671d02745efabe7e6b8bdf0ad21f8762c | refs/heads/master | 2023-08-17T04:29:00.904122 | 2023-05-23T09:18:09 | 2023-05-23T09:18:09 | 226,960,272 | 3 | 2 | MIT | 2023-07-19T02:13:18 | 2019-12-09T20:21:59 | Python | UTF-8 | Python | false | false | 660 | pyi | # Stubs for pandas.tests.indexes.test_setops (Python 3)
#
# NOTE: This dynamically typed stub was automatically generated by stubgen.
# pylint: disable=unused-argument,redefined-outer-name,no-self-use,invalid-name
# pylint: disable=relative-beyond-top-level
from typing import Any
COMPATIBLE_INCONSISTENT_PAIRS: Any
... | [
"josua.krause@gmail.com"
] | josua.krause@gmail.com |
cc6016e65e7b3e125b87d996e95b98ff5f2a1e52 | c17ca7a7824056f7ad58d0f71abc25670b20c1fc | /spirit/urls/admin/__init__.py | 1bc65e9f0daf9e9e944ad49a9811b0f1d6942c43 | [
"Apache-2.0"
] | permissive | Si-elegans/Web-based_GUI_Tools | cd35b72e80aa400105593c5c819355437e204a81 | 58a9b7a76bc46467554192a38ff5329a94e2b627 | refs/heads/master | 2023-01-11T09:11:21.896172 | 2017-07-18T11:10:31 | 2017-07-18T11:10:31 | 97,445,306 | 3 | 1 | Apache-2.0 | 2022-12-26T20:14:59 | 2017-07-17T07:03:13 | JavaScript | UTF-8 | Python | false | false | 536 | py | #-*- coding: utf-8 -*-
from django.conf.urls import patterns, include, url
urlpatterns = patterns('',
url(r'^$', 'spirit.views.admin.index.dashboard', name='admin'),
url(r'^index/', include('spirit.urls.admin.index')),
url(r'^category/', include('spirit.urls.admin.category')),
url(r'^comment/flag/', ... | [
"gepelde@vicomtech.org"
] | gepelde@vicomtech.org |
1d8542da9fe05431ce0785b0c97e19b60e7aec39 | e15ec378360536d5215bf0f0a8fa9ab8a41ff6cc | /ch06/p6-3-1.py | 344f657d4d90d4170ca1d407f4091c37e6166324 | [] | no_license | michlin0825/book-mP21926 | 2ece5685ded2c913f51c830fd6f3280b8394646f | 5c4ebd828e593efd5fc7ba40bbcf606babd52640 | refs/heads/main | 2023-01-02T05:48:49.832014 | 2020-10-12T02:22:21 | 2020-10-12T02:22:21 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 433 | py | from selenium import webdriver
from bs4 import BeautifulSoup
import time
url = 'https://www.cwb.gov.tw/V8/C/W/OBS_County.html?ID=menu'
web = webdriver.Chrome('chromedriver.exe')
web.implicitly_wait(60)
web.get(url)
html = web.page_source
web.quit()
soup = BeautifulSoup(html, 'html.parser')
target = soup.select('#Count... | [
"skynet.tw@gmail.com"
] | skynet.tw@gmail.com |
0c826b71c27b17e526b9807cbca19ce674539404 | b57d337ddbe946c113b2228a0c167db787fd69a1 | /scr/py00468notices.py | c8f23c8ddfd5182e7ed018cb580fa0c212a0c0c1 | [] | no_license | aademchenko/ToEE | ebf6432a75538ae95803b61c6624e65b5cdc53a1 | dcfd5d2de48b9d9031021d9e04819b309d71c59e | refs/heads/master | 2020-04-06T13:56:27.443772 | 2018-11-14T09:35:57 | 2018-11-14T09:35:57 | 157,520,715 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,612 | py | from toee import *
from utilities import *
import _include
from co8Util.TimedEvent import *
from combat_standard_routines import *
from py00439script_daemon import get_f, set_f, get_v, set_v, tpsts, record_time_stamp
def san_use( attachee, triggerer ):
if (attachee.name == 11063):
game.quests[110].state = qs_menti... | [
"demchenko.recruitment@gmail.com"
] | demchenko.recruitment@gmail.com |
4981a7e806be3173914d83131e900e93b70cefac | c89f5856fe74cff49a9d96dde9ed0117109e3845 | /A-bit-of-py/exceptions_raise.py | 18c685701366068a4acd2f51c1194d541cbb8930 | [] | no_license | sinoclover/python | b2b3f435d15840ec16a34c62d50308bdfb9d6c3e | 02f5347bc8219f1df52486077adf0017fe6d5211 | refs/heads/master | 2020-08-27T22:14:20.672846 | 2019-12-01T13:27:42 | 2019-12-01T13:27:42 | 158,791,898 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 647 | py | # encoding=UTF-8
class ShortInputException(Exception):
'''一个由用户定义的异常类'''
def __init__(self, length, atleast):
Exception.__init__(self)
self.length = length
self.atleast = atleast
try:
text = input('Enter something --> ')
if len(text) < 3:
raise ShortInputException(len(t... | [
"zzxy123007@163.com"
] | zzxy123007@163.com |
4fc31a6ff5a7263512d12b5b20ad20f35c45dff3 | 2c510687bdc03fbb8383130e68cc796bfef1088c | /3_basic_ds/exercises.py | 328dff7335a429dab792cb7b5a6f8adc62aeda37 | [] | no_license | jimjshields/pswads | 59758a0972fe71ca6f77305ff8ab86673d9b5d46 | 9568622805e24416f4a227cbecc1ef4927fa7ba3 | refs/heads/master | 2016-09-06T12:37:53.254464 | 2015-02-17T02:13:00 | 2015-02-17T02:13:00 | 30,149,564 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,772 | py | # Chapter 3 Programming Exercises
# Skip all pre-/post-/infix questions; not worth the time.
# Also skip any 'experiment' questions. Maybe come back to them.
# 5. Implement the Queue ADT, using a list such that the rear of the queue is at the end of the list.
class Queue(object):
"""Represents a queue ADT. The rear ... | [
"jim.j.shields@gmail.com"
] | jim.j.shields@gmail.com |
e103e52c8d1db2ceda089eb62bb3d134391fee80 | 102a33464fd3a16ceedd134e9c64fea554ca5273 | /apps/config/models.py | 39260020ed66b83fc8e77d4bf08ecae9ee053a6b | [] | no_license | pythonguru101/django-ecommerce | b688bbe2b1a53c906aa80f86f764cf9787e6c2fe | f94de9c21223716db5ffcb86ba87219da88d2ff4 | refs/heads/master | 2020-07-24T14:57:02.047702 | 2020-06-10T06:06:23 | 2020-06-10T06:06:23 | 207,961,132 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,658 | py | # encoding: utf-8
from django.db import models
from django.utils.translation import ugettext as _
class ConfigAbstractManager(models.Manager):
def get_config(self):
try:
return self.get(pk=1)
except self.model.DoesNotExist:
return {}
class ConfigAbstract(models.Model):
... | [
"pythonguru101@gmail.com"
] | pythonguru101@gmail.com |
fa27bce37bd4a31c0734171d2f4b56a9949bad56 | d52413173437ba73ecdf822ca895e659f00a8ce7 | /kiwibackend/application/module/artifact/migrations/0003_auto_20151209_1606.py | 66ae6b692b0125f17dbbc5170a7fce62dbc9ac44 | [] | no_license | whiteprism/mywork | 2329b3459c967c079d6185c5acabd6df80cab8ea | a8e568e89744ca7acbc59e4744aff2a0756d7252 | refs/heads/master | 2021-01-21T11:15:49.090408 | 2017-03-31T03:28:13 | 2017-03-31T03:28:13 | 83,540,646 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 946 | py | # -*- coding: utf-8 -*-
from __future__ import unicode_literals
from django.db import models, migrations
class Migration(migrations.Migration):
dependencies = [
('artifact', '0002_auto_20150914_0908'),
]
operations = [
migrations.AddField(
model_name='artifact',
... | [
"snoster@163.com"
] | snoster@163.com |
cb1b755acd76f9db92cf7cb4a054a194126f2c56 | 2cf87feeebfe128d6c60067e82e5b28b3a84ae45 | /aracle/data/make3dslices.py | a5b16c308b96da0c083019c4adf28e64496bd654 | [
"MIT"
] | permissive | jiwoncpark/aracle | b536fbea39480b7af96daff1a9c51d2a7f131866 | 20aabe27ce65b738b77192242dc89eda612f945e | refs/heads/master | 2020-06-03T15:21:35.386628 | 2019-11-12T17:49:34 | 2019-11-12T17:49:34 | 191,626,657 | 1 | 1 | null | null | null | null | UTF-8 | Python | false | false | 4,320 | py | import drms #pip install drms, astropy, sunpy , skvideo
import numpy as np
import astropy.units as u
import shutil
import os
import datetime
import matplotlib.pyplot as plt
import skvideo.io
from astropy.io import fits
from matplotlib.pyplot import imshow
from PIL import Image
from sunpy.map import Map
from datetime im... | [
"jiwon.christine.park@gmail.com"
] | jiwon.christine.park@gmail.com |
97176f4b2cf2a2706ba0989eee781b449a4cf6b0 | 14cdc1353affd01ec9f96c31cd51549d82364b2c | /test/IECore/OptionsTest.py | f257f594de42cc75781eb2db60bfa267e5f96a44 | [] | no_license | dsparrow27/cortex | f787cdcc271388986cd24ee27b48999ae71ef194 | 5e985efa860aec22a0c8ec6cebf9e682f65eca73 | refs/heads/master | 2021-08-19T06:30:36.881268 | 2017-11-23T08:26:13 | 2017-11-23T08:26:13 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,627 | py | ##########################################################################
#
# Copyright (c) 2012, John Haddon. All rights reserved.
#
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions are
# met:
#
# * Redistributions of sou... | [
"thehaddonyoof@gmail.com"
] | thehaddonyoof@gmail.com |
49716fffe1d3d747365e83abe99f48f2a62222a2 | be5c86e8fe3f5836b7d2097dd5272c72b5b28f15 | /binary-search/Python/0374-guess-number-higher-or-lower.py | bca7b49cffd223314f15f7da64b8be501150cf07 | [
"Apache-2.0"
] | permissive | lemonnader/LeetCode-Solution-Well-Formed | d24674898ceb5441c036016dc30afc58e4a1247a | baabdb1990fd49ab82a712e121f49c4f68b29459 | refs/heads/master | 2021-04-23T18:49:40.337569 | 2020-03-24T04:50:27 | 2020-03-24T04:50:27 | 249,972,064 | 1 | 0 | Apache-2.0 | 2020-03-25T12:26:25 | 2020-03-25T12:26:24 | null | UTF-8 | Python | false | false | 523 | py | # The guess API is already defined for you.
# @param num, your guess
# @return -1 if my number is lower, 1 if my number is higher, otherwise return 0
def guess(num):
pass
class Solution(object):
def guessNumber(self, n):
left = 1
right = n
while left < right:
mid = (left + ... | [
"121088825@qq.com"
] | 121088825@qq.com |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.